--- a/ocpp/LICENSE
+++ b/ocpp/LICENSE
@@ -0,0 +1,21 @@
 
				+MIT License
			
 
				+
			
 
				+Copyright (c) 2019 The Mobility House
			
 
				+
			
 
				+Permission is hereby granted, free of charge, to any person obtaining a copy
			
 
				+of this software and associated documentation files (the "Software"), to deal
			
 
				+in the Software without restriction, including without limitation the rights
			
 
				+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
			
 
				+copies of the Software, and to permit persons to whom the Software is
			
 
				+furnished to do so, subject to the following conditions:
			
 
				+
			
 
				+The above copyright notice and this permission notice shall be included in all
			
 
				+copies or substantial portions of the Software.
			
 
				+
			
 
				+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
			
 
				+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
			
 
				+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
			
 
				+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
			
 
				+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
			
 
				+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
			
 
				+SOFTWARE.
			
--- a/ocpp/MANIFEST.in
+++ b/ocpp/MANIFEST.in
@@ -0,0 +1,3 @@
 
				+recursive-exclude tests *
			
 
				+recursive-include ocpp/v16/schemas *.json
			
 
				+recursive-include ocpp/v20/schemas *.json
			
--- a/ocpp/Makefile
+++ b/ocpp/Makefile
@@ -0,0 +1,57 @@
 
				+.PHONY: help .check-pypi-envs .install-poetry update install docs tests build deploy
			
 
				+
			
 
				+.DEFAULT_GOAL := help
			
 
				+
			
 
				+export PATH := ${HOME}/.local/bin:$(PATH)
			
 
				+
			
 
				+IS_POETRY := $(shell pip freeze | grep "poetry==")
			
 
				+
			
 
				+CURRENT_VERSION := $(shell poetry version -s)
			
 
				+
			
 
				+help:
			
 
				+	@echo "Please use 'make <target>', where <target> is one of"
			
 
				+	@echo ""
			
 
				+	@echo "  build                            builds the project .whl with poetry"
			
 
				+	@echo "  deploy                           deploys the project using poetry (not recommended, only use if really needed)"
			
 
				+	@echo "  help                             outputs this helper"
			
 
				+	@echo "  install                          installs the dependencies in the env"
			
 
				+	@echo "  release version=<sem. version>   bumps the project version to <sem. version>, using poetry;"
			
 
				+	@echo "                                   Updates also docs/source/conf.py version;"
			
 
				+	@echo "                                   If no version is provided, poetry outputs the current project version"
			
 
				+	@echo "  test                             run all the tests and linting"
			
 
				+	@echo "  update                           updates the dependencies in poetry.lock"
			
 
				+	@echo ""
			
 
				+	@echo "Check the Makefile to know exactly what each target is doing."
			
 
				+
			
 
				+
			
 
				+.install-poetry:
			
 
				+	@if [ -z ${IS_POETRY} ]; then pip install poetry; fi
			
 
				+
			
 
				+update: .install-poetry
			
 
				+	poetry update
			
 
				+
			
 
				+install: .install-poetry
			
 
				+	poetry install
			
 
				+
			
 
				+docs: .install-poetry
			
 
				+	poetry run sphinx-build -b html docs/source docs/build
			
 
				+
			
 
				+format: .install-poetry
			
 
				+	poetry run isort ocpp tests  && poetry run black ocpp tests
			
 
				+
			
 
				+tests: .install-poetry
			
 
				+	poetry run black --check --diff ocpp tests
			
 
				+	poetry run isort --check-only ocpp tests
			
 
				+	poetry run flake8 ocpp tests
			
 
				+	poetry run py.test -vvv --cov=ocpp --cov-report=term-missing tests/
			
 
				+
			
 
				+build: .install-poetry
			
 
				+	poetry build
			
 
				+
			
 
				+release: .install-poetry
			
 
				+	@echo "Please remember to update the CHANGELOG.md, before tagging the release"
			
 
				+	@sed -i ".bkp" "s/release = '${CURRENT_VERSION}'/release = '${version}'/g" docs/source/conf.py
			
 
				+	@poetry version ${version}
			
 
				+
			
 
				+deploy: update tests
			
 
				+	poetry publish --build
			
--- a/ocpp/README.rst
+++ b/ocpp/README.rst
@@ -0,0 +1,206 @@
 
				+.. image:: https://github.com/mobilityhouse/ocpp/actions/workflows/pull-request.yml/badge.svg?style=svg
			
 
				+   :target: https://github.com/mobilityhouse/ocpp/actions/workflows/pull-request.yml
			
 
				+
			
 
				+.. image:: https://img.shields.io/pypi/pyversions/ocpp.svg
			
 
				+   :target: https://pypi.org/project/ocpp/
			
 
				+
			
 
				+.. image:: https://img.shields.io/readthedocs/ocpp.svg
			
 
				+   :target: https://ocpp.readthedocs.io/en/latest/
			
 
				+
			
 
				+OCPP
			
 
				+----
			
 
				+
			
 
				+Python package implementing the JSON version of the Open Charge Point Protocol
			
 
				+(OCPP). Currently OCPP 1.6 (errata v4), OCPP 2.0 and OCPP 2.0.1 (Final Version)
			
 
				+are supported.
			
 
				+
			
 
				+You can find the documentation on `rtd`_.
			
 
				+
			
 
				+Installation
			
 
				+------------
			
 
				+
			
 
				+You can either the project install from Pypi:
			
 
				+
			
 
				+.. code-block:: bash
			
 
				+
			
 
				+   $ pip install ocpp
			
 
				+
			
 
				+Or clone the project and install it manually using:
			
 
				+
			
 
				+.. code-block:: bash
			
 
				+
			
 
				+   $ pip install .
			
 
				+
			
 
				+Quick start
			
 
				+-----------
			
 
				+
			
 
				+Below you can find examples on how to create a simple OCPP 2.0 central system as
			
 
				+well as an OCPP 2.0 charge point.
			
 
				+
			
 
				+.. note::
			
 
				+
			
 
				+   To run these examples the dependency websockets_ is required! Install it by running:
			
 
				+
			
 
				+   .. code-block:: bash
			
 
				+
			
 
				+      $ pip install websockets
			
 
				+
			
 
				+Central system
			
 
				+~~~~~~~~~~~~~~
			
 
				+
			
 
				+The code snippet below creates a simple OCPP 2.0 central system which is able
			
 
				+to handle BootNotification calls. You can find a detailed explanation of the
			
 
				+code in the `Central System documentation`_.
			
 
				+
			
 
				+
			
 
				+.. code-block:: python
			
 
				+
			
 
				+    import asyncio
			
 
				+    import logging
			
 
				+    import websockets
			
 
				+    from datetime import datetime
			
 
				+
			
 
				+    from ocpp.routing import on
			
 
				+    from ocpp.v201 import ChargePoint as cp
			
 
				+    from ocpp.v201 import call_result
			
 
				+    from ocpp.v201.enums import RegistrationStatusType
			
 
				+
			
 
				+    logging.basicConfig(level=logging.INFO)
			
 
				+
			
 
				+
			
 
				+    class ChargePoint(cp):
			
 
				+        @on('BootNotification')
			
 
				+        async def on_boot_notification(self, charging_station, reason, **kwargs):
			
 
				+            return call_result.BootNotificationPayload(
			
 
				+                current_time=datetime.utcnow().isoformat(),
			
 
				+                interval=10,
			
 
				+                status=RegistrationStatusType.accepted
			
 
				+            )
			
 
				+
			
 
				+
			
 
				+    async def on_connect(websocket, path):
			
 
				+        """ For every new charge point that connects, create a ChargePoint
			
 
				+        instance and start listening for messages.
			
 
				+        """
			
 
				+        try:
			
 
				+            requested_protocols = websocket.request_headers[
			
 
				+                'Sec-WebSocket-Protocol']
			
 
				+        except KeyError:
			
 
				+            logging.info("Client hasn't requested any Subprotocol. "
			
 
				+                     "Closing Connection")
			
 
				+            return await websocket.close()
			
 
				+
			
 
				+        if websocket.subprotocol:
			
 
				+            logging.info("Protocols Matched: %s", websocket.subprotocol)
			
 
				+        else:
			
 
				+            # In the websockets lib if no subprotocols are supported by the
			
 
				+            # client and the server, it proceeds without a subprotocol,
			
 
				+            # so we have to manually close the connection.
			
 
				+            logging.warning('Protocols Mismatched | Expected Subprotocols: %s,'
			
 
				+                            ' but client supports  %s | Closing connection',
			
 
				+                            websocket.available_subprotocols,
			
 
				+                            requested_protocols)
			
 
				+            return await websocket.close()
			
 
				+
			
 
				+        charge_point_id = path.strip('/')
			
 
				+        cp = ChargePoint(charge_point_id, websocket)
			
 
				+
			
 
				+        await cp.start()
			
 
				+
			
 
				+
			
 
				+    async def main():
			
 
				+        server = await websockets.serve(
			
 
				+            on_connect,
			
 
				+            '0.0.0.0',
			
 
				+            9000,
			
 
				+            subprotocols=['ocpp2.0.1']
			
 
				+        )
			
 
				+        logging.info("WebSocket Server Started")
			
 
				+        await server.wait_closed()
			
 
				+
			
 
				+    if __name__ == '__main__':
			
 
				+        asyncio.run(main())
			
 
				+
			
 
				+Charge point
			
 
				+~~~~~~~~~~~~
			
 
				+
			
 
				+.. code-block:: python
			
 
				+
			
 
				+    import asyncio
			
 
				+
			
 
				+    from ocpp.v201.enums import RegistrationStatusType
			
 
				+    import logging
			
 
				+    import websockets
			
 
				+
			
 
				+    from ocpp.v201 import call
			
 
				+    from ocpp.v201 import ChargePoint as cp
			
 
				+
			
 
				+    logging.basicConfig(level=logging.INFO)
			
 
				+
			
 
				+
			
 
				+    class ChargePoint(cp):
			
 
				+
			
 
				+        async def send_boot_notification(self):
			
 
				+            request = call.BootNotificationPayload(
			
 
				+                charging_station={
			
 
				+                    'model': 'Wallbox XYZ',
			
 
				+                    'vendor_name': 'anewone'
			
 
				+                },
			
 
				+                reason="PowerUp"
			
 
				+            )
			
 
				+            response = await self.call(request)
			
 
				+
			
 
				+            if response.status == RegistrationStatusType.accepted:
			
 
				+                print("Connected to central system.")
			
 
				+
			
 
				+
			
 
				+    async def main():
			
 
				+        async with websockets.connect(
			
 
				+                'ws://localhost:9000/CP_1',
			
 
				+                subprotocols=['ocpp2.0.1']
			
 
				+        ) as ws:
			
 
				+            cp = ChargePoint('CP_1', ws)
			
 
				+
			
 
				+            await asyncio.gather(cp.start(), cp.send_boot_notification())
			
 
				+
			
 
				+
			
 
				+    if __name__ == '__main__':
			
 
				+        asyncio.run(main())
			
 
				+
			
 
				+Debugging
			
 
				+---------
			
 
				+
			
 
				+Python's default log level is `logging.WARNING`. As result most of the logs
			
 
				+generated by this package are discarded. To see the log output of this package
			
 
				+lower the log level to `logging.DEBUG`.
			
 
				+
			
 
				+.. code-block:: python
			
 
				+
			
 
				+  import logging
			
 
				+  logging.basicConfig(level=logging.DEBUG)
			
 
				+
			
 
				+However, this approach defines the log level for the complete logging system.
			
 
				+In other words: the log level of all dependencies is set to `logging.DEBUG`.
			
 
				+
			
 
				+To lower the logs for this package only use the following code:
			
 
				+
			
 
				+.. code-block:: python
			
 
				+
			
 
				+  import logging
			
 
				+  logging.getLogger('ocpp').setLevel(level=logging.DEBUG)
			
 
				+  logging.getLogger('ocpp').addHandler(logging.StreamHandler())
			
 
				+
			
 
				+License
			
 
				+-------
			
 
				+
			
 
				+Except from the documents in `docs/v16` and `docs/v201` everything is licensed under MIT_.
			
 
				+© `The Mobility House`_
			
 
				+
			
 
				+The documents in `docs/v16` and `docs/v201` are licensed under Creative Commons
			
 
				+Attribution-NoDerivatives 4.0 International Public License.
			
 
				+
			
 
				+.. _Central System documentation: https://ocpp.readthedocs.io/en/latest/central_system.html
			
 
				+.. _MIT: https://github.com/mobilityhouse/ocpp/blob/master/LICENSE
			
 
				+.. _rtd: https://ocpp.readthedocs.io/en/latest/index.html
			
 
				+.. _The Mobility House: https://www.mobilityhouse.com/int_en/
			
 
				+.. _websockets: https://pypi.org/project/websockets/
			
--- a/ocpp/docs/source/README.rst
+++ b/ocpp/docs/source/README.rst
@@ -0,0 +1,4 @@
 
				+Getting started
			
 
				+===============
			
 
				+
			
 
				+.. include:: ../../README.rst
			
--- a/ocpp/docs/source/central_system.rst
+++ b/ocpp/docs/source/central_system.rst
@@ -0,0 +1,180 @@
 
				+Central System
			
 
				+==============
			
 
				+
			
 
				+The Open Charge Point Protocol defines two roles: the charge point (or the client) and the central
			
 
				+server (or the server). The ocpp Python package can be used to model both sides of the connection.
			
 
				+
			
 
				+This document explains how to create a central system and how to model a charge
			
 
				+point at server side. Most of the examples on this page use the `websockets`_
			
 
				+library as implementation of the websockets layer. Note that package isn't
			
 
				+required, other websocket implementations might work as well.
			
 
				+
			
 
				+
			
 
				+Create a websocket server
			
 
				+-------------------------
			
 
				+
			
 
				+The snippet below creates a very simple websocket server that listens at port 9000 for connections
			
 
				+and that prints 'Charge point connected' for every new websocket connection made.
			
 
				+
			
 
				+.. code-block:: python
			
 
				+
			
 
				+   import asyncio
			
 
				+   import websockets
			
 
				+
			
 
				+
			
 
				+   async def on_connect(websocket, path):
			
 
				+      await websocket.send('Connection made successfully.')
			
 
				+      print(f'Charge point {path} connected')
			
 
				+
			
 
				+
			
 
				+   async def main():
			
 
				+      server = await websockets.serve(
			
 
				+         on_connect,
			
 
				+         '0.0.0.0',
			
 
				+         9000,
			
 
				+         subprotocols=['ocpp1.6']
			
 
				+      )
			
 
				+
			
 
				+      await server.wait_closed()
			
 
				+
			
 
				+
			
 
				+   if __name__ == '__main__':
			
 
				+      asyncio.run(main())
			
 
				+
			
 
				+There are two things that requires a few words of explanation.
			
 
				+
			
 
				+* The `on_connect()` handler that is passed as a first argument to `websockets.serve()`_. This is
			
 
				+  the handler that is executed on every new connection.
			
 
				+
			
 
				+  The handler is passed two arguments: an instance of `websockets.server.WebSocketServerProtocol`_
			
 
				+  and the request URI. The request URI is used as identifier for the charge point that made the
			
 
				+  connection. To quote a snippet from section 3.1.1 of the OCPP-J specification:
			
 
				+
			
 
				+	*"The charge point's connection URL contains the charge point identity
			
 
				+	so that the Central System knows which charge point a Websocket connection
			
 
				+	belongs to."*
			
 
				+
			
 
				+  The handler in this example sends a message to the client and prints a message to the console.
			
 
				+
			
 
				+
			
 
				+* The `subprotocols` argument in `websockets.serve()` is used to configure the server that it
			
 
				+  supports OCPP 1.6.
			
 
				+
			
 
				+After you've started the server you can connect a client to it by using the `websockets` interactive
			
 
				+`client`_:
			
 
				+
			
 
				+
			
 
				+.. code-block:: shell
			
 
				+
			
 
				+   $ python -m websockets ws://localhost:9000/test_charge_point
			
 
				+   Connected to ws://localhost:9000/test_charge_point.
			
 
				+   < Connection made successfully.
			
 
				+   Connection closed: code = 1000 (OK), no reason.
			
 
				+
			
 
				+
			
 
				+OCPP compliant handler
			
 
				+----------------------
			
 
				+
			
 
				+.. note::
			
 
				+
			
 
				+   This document describes how to create an central system that supports OCPP
			
 
				+   1.6. The ocpp Python package has support for OCPP 2.0 as well. This
			
 
				+   documentation will be updated soon to reflect that. In the mean time please
			
 
				+   consult the `examples/`_ to learn how to create an OCPP 2.0 central system.
			
 
				+
			
 
				+The websocket server created above is not very useful and only sends a non-OCPP compliant message.
			
 
				+
			
 
				+Remove the `on_connect()` handler from the code above and replace it by the following snippet.
			
 
				+
			
 
				+.. code-block:: python
			
 
				+
			
 
				+   from datetime import datetime
			
 
				+
			
 
				+   from ocpp.routing import on
			
 
				+   from ocpp.v16 import ChargePoint as cp
			
 
				+   from ocpp.v16.enums import Action, RegistrationStatus
			
 
				+   from ocpp.v16 import call_result
			
 
				+
			
 
				+
			
 
				+   class MyChargePoint(cp):
			
 
				+       @on(Action.BootNotification)
			
 
				+       async def on_boot_notification(self, charge_point_vendor, charge_point_model, **kwargs):
			
 
				+           return call_result.BootNotificationPayload(
			
 
				+               current_time=datetime.utcnow().isoformat(),
			
 
				+               interval=10,
			
 
				+               status=RegistrationStatus.accepted
			
 
				+           )
			
 
				+
			
 
				+
			
 
				+   async def on_connect(websocket, path):
			
 
				+       """ For every new charge point that connects, create a ChargePoint instance
			
 
				+       and start listening for messages.
			
 
				+
			
 
				+       """
			
 
				+       charge_point_id = path.strip('/')
			
 
				+       cp = MyChargePoint(charge_point_id, websocket)
			
 
				+
			
 
				+       await cp.start()
			
 
				+
			
 
				+
			
 
				+The `on_connect()` handler has been updated and now creates a `MyChargePoint` instance and calls the
			
 
				+`start()`_ coroutine.
			
 
				+
			
 
				+`MyChargePoint` subclasses from `ocpp.v16.ChargePoint`_. `ocpp.v16.ChargePoint` is the core of the
			
 
				+ocpp package. This class implements the routing of messages coming from the client to the correct handler.
			
 
				+It also will validate all messages that are being received or being send to the client and it
			
 
				+implements flow control.
			
 
				+
			
 
				+Our `MyChargePoint` class uses the `@on()`_ decorator to implement a handler for 'BootNotification'
			
 
				+requests. The `@on()` takes a string with the name of an action as only argument. Although not used
			
 
				+in this example, the package also provides an `@after()`_ decorator that can be used the register a
			
 
				+post request handler.
			
 
				+
			
 
				+According to the OCPP specification a payload of a BootNotification request must contain two
			
 
				+required arguments, 'chargePointModel' and 'chargePointVendor', as well as an seven optional
			
 
				+arguments. The handler reflects this by having two required arguments, `charge_point_vendor` and
			
 
				+`charge_point_model`. The handler uses `**kwargs` for the optional arguments.
			
 
				+
			
 
				+The handler returns an instance of `ocpp.v16.call_result.BootNotificationPayload`_. This object
			
 
				+is used to create a response that is send back to the client.
			
 
				+
			
 
				+.. note::
			
 
				+
			
 
				+   OCPP uses a camelCase naming scheme for the keys in the payload. Python, on
			
 
				+   the other hand, uses snake_case.
			
 
				+
			
 
				+   Therefore this ocpp package converts all keys in messages from camelCase to
			
 
				+   snake_case and vice versa to make sure you can write Pythonic code.
			
 
				+
			
 
				+
			
 
				+Now start the websocket server again and connect a client to it as you did before. If the client is
			
 
				+connected send this BootNotification to the central system:
			
 
				+
			
 
				+.. code-block:: shell
			
 
				+
			
 
				+	`[2, "12345", "BootNotification", {"chargePointVendor": "The Mobility House", "chargePointModel": "Optimus"}]`
			
 
				+
			
 
				+The server should respond and the you should see something like this:
			
 
				+
			
 
				+.. code-block:: shell
			
 
				+
			
 
				+   $ python -m websockets ws://localhost:9000/test_charge_point
			
 
				+   Connected to ws://localhost:9000/test_charge_point.
			
 
				+   > [2, "12345", "BootNotification", {"chargePointVendor": "The Mobility House", "chargePointModel": "Optimus"}]
			
 
				+   < [3, "12345", {"currentTime": "2019-06-16T11:18:09.591716", "interval": 10, "status": "Accepted"}]`
			
 
				+
			
 
				+Congratulations! You've created a central system.
			
 
				+
			
 
				+You can find the source code of the central system created in this document in the `examples/`_
			
 
				+directory.
			
 
				+
			
 
				+.. _client: https://websockets.readthedocs.io/en/stable/intro.html#one-more-thing
			
 
				+.. _examples/: https://github.com/mobilityhouse/ocpp/blob/master/examples
			
 
				+.. _ocpp.v16.call_result.BootNotificationPayload: https://github.com/mobilityhouse/ocpp/blob/3b92c2c53453dd6511a202e1dc1b9aa1a236389e/ocpp/v16/call_result.py#L28
			
 
				+.. _ocpp.v16.ChargePoint: https://github.com/mobilityhouse/ocpp/blob/master/ocpp/v16/charge_point.py#L80
			
 
				+.. _start(): https://github.com/mobilityhouse/ocpp/blob/3b92c2c53453dd6511a202e1dc1b9aa1a236389e/ocpp/v16/charge_point.py#L125
			
 
				+.. _websockets: https://websockets.readthedocs.io/en/stable/
			
 
				+.. _websockets.serve(): https://websockets.readthedocs.io/en/stable/api.html#module-websockets.server
			
 
				+.. _websockets.server.WebsocketServerProtocol: https://websockets.readthedocs.io/en/stable/api.html#websockets.server.WebSocketServerProtocol
			
 
				+.. _@on(): https://github.com/mobilityhouse/ocpp/blob/3b92c2c53453dd6511a202e1dc1b9aa1a236389e/ocpp/routing.py#L4
			
 
				+.. _@after(): https://github.com/mobilityhouse/ocpp/blob/3b92c2c53453dd6511a202e1dc1b9aa1a236389e/ocpp/routing.py#L34
			
--- a/ocpp/docs/source/client.rst
+++ b/ocpp/docs/source/client.rst
--- a/ocpp/docs/source/conf.py
+++ b/ocpp/docs/source/conf.py
@@ -0,0 +1,56 @@
 
				+# Configuration file for the Sphinx documentation builder.
			
 
				+#
			
 
				+# This file only contains a selection of the most common options. For a full
			
 
				+# list see the documentation:
			
 
				+# http://www.sphinx-doc.org/en/master/config
			
 
				+
			
 
				+# -- Path setup --------------------------------------------------------------
			
 
				+
			
 
				+# If extensions (or modules to document with autodoc) are in another directory,
			
 
				+# add these directories to sys.path here. If the directory is relative to the
			
 
				+# documentation root, use os.path.abspath to make it absolute, like shown here.
			
 
				+#
			
 
				+import os
			
 
				+import sys
			
 
				+
			
 
				+sys.path.insert(0, os.path.abspath("../../"))
			
 
				+
			
 
				+
			
 
				+# -- Project information -----------------------------------------------------
			
 
				+
			
 
				+project = "OCPP"
			
 
				+copyright = "2023, Auke Willem Oosterhoff"
			
 
				+author = "Auke Willem Oosterhoff"
			
 
				+
			
 
				+# The full version, including alpha/beta/rc tags
			
 
				+release = "0.25.0"
			
 
				+
			
 
				+
			
 
				+# -- General configuration ---------------------------------------------------
			
 
				+
			
 
				+# Add any Sphinx extension module names here, as strings. They can be
			
 
				+# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom
			
 
				+# ones.
			
 
				+extensions = ["sphinx.ext.autodoc"]
			
 
				+
			
 
				+# Add any paths that contain templates here, relative to this directory.
			
 
				+templates_path = ["_templates"]
			
 
				+
			
 
				+# List of patterns, relative to source directory, that match files and
			
 
				+# directories to ignore when looking for source files.
			
 
				+# This pattern also affects html_static_path and html_extra_path.
			
 
				+exclude_patterns = []
			
 
				+
			
 
				+master_doc = "index"
			
 
				+
			
 
				+# -- Options for HTML output -------------------------------------------------
			
 
				+
			
 
				+# The theme to use for HTML and HTML Help pages.  See the documentation for
			
 
				+# a list of builtin themes.
			
 
				+#
			
 
				+html_theme = "alabaster"
			
 
				+
			
 
				+# Add any paths that contain custom static files (such as style sheets) here,
			
 
				+# relative to this directory. They are copied after the builtin static files,
			
 
				+# so a file named "default.css" will overwrite the builtin "default.css".
			
 
				+html_static_path = ["_static"]
			
--- a/ocpp/docs/source/index.rst
+++ b/ocpp/docs/source/index.rst
@@ -0,0 +1,15 @@
 
				+.. OCPP documentation master file, created by
			
 
				+   sphinx-quickstart on Tue May 28 20:40:32 2019.
			
 
				+   You can adapt this file completely to your liking, but it should at least
			
 
				+   contain the root `toctree` directive.
			
 
				+
			
 
				+.. include:: ../../README.rst
			
 
				+
			
 
				+Index
			
 
				+-----
			
 
				+
			
 
				+.. toctree::
			
 
				+   :maxdepth: 2
			
 
				+
			
 
				+   README
			
 
				+   central_system
			
--- a/ocpp/docs/v16/ocpp-1.6
+++ b/ocpp/docs/v16/ocpp-1.6
--- a/ocpp/docs/v16/ocpp-1.6-errata-sheet.pdf
+++ b/ocpp/docs/v16/ocpp-1.6-errata-sheet.pdf
--- a/ocpp/docs/v16/ocpp-1.6-security-whitepaper-edition-2.pdf
+++ b/ocpp/docs/v16/ocpp-1.6-security-whitepaper-edition-2.pdf
--- a/ocpp/docs/v16/ocpp-1.6.pdf
+++ b/ocpp/docs/v16/ocpp-1.6.pdf
--- a/ocpp/docs/v16/ocpp-j-1.6-errata-sheet.pdf
+++ b/ocpp/docs/v16/ocpp-j-1.6-errata-sheet.pdf
--- a/ocpp/docs/v16/ocpp-j-1.6-specification.pdf
+++ b/ocpp/docs/v16/ocpp-j-1.6-specification.pdf
--- a/ocpp/docs/v201/Changelog
+++ b/ocpp/docs/v201/Changelog
--- a/ocpp/docs/v201/OCPP-2.0.1_edition2_errata_2023-12.pdf
+++ b/ocpp/docs/v201/OCPP-2.0.1_edition2_errata_2023-12.pdf
--- a/ocpp/docs/v201/OCPP-2.0.1_part0_introduction.pdf
+++ b/ocpp/docs/v201/OCPP-2.0.1_part0_introduction.pdf
--- a/ocpp/docs/v201/OCPP-2.0.1_part1_architecture_topology.pdf
+++ b/ocpp/docs/v201/OCPP-2.0.1_part1_architecture_topology.pdf
--- a/ocpp/docs/v201/OCPP-2.0.1_part2_appendices_v13.pdf
+++ b/ocpp/docs/v201/OCPP-2.0.1_part2_appendices_v13.pdf
--- a/ocpp/docs/v201/OCPP-2.0.1_part2_errata_v20.pdf
+++ b/ocpp/docs/v201/OCPP-2.0.1_part2_errata_v20.pdf
--- a/ocpp/docs/v201/OCPP-2.0.1_part2_specification_edition2.pdf
+++ b/ocpp/docs/v201/OCPP-2.0.1_part2_specification_edition2.pdf
--- a/ocpp/docs/v201/OCPP-2.0.1_part4_ocpp-j-specification.pdf
+++ b/ocpp/docs/v201/OCPP-2.0.1_part4_ocpp-j-specification.pdf
--- a/ocpp/docs/v201/OCPP-2.0.1_part5_certification_profiles.pdf
+++ b/ocpp/docs/v201/OCPP-2.0.1_part5_certification_profiles.pdf
--- a/ocpp/docs/v201/OCPP-2.0.1_part6_test_cases.pdf
+++ b/ocpp/docs/v201/OCPP-2.0.1_part6_test_cases.pdf
--- a/ocpp/examples/v16/central_system.py
+++ b/ocpp/examples/v16/central_system.py
@@ -0,0 +1,76 @@
 
				+import asyncio
			
 
				+import logging
			
 
				+from datetime import datetime
			
 
				+
			
 
				+try:
			
 
				+    import websockets
			
 
				+except ModuleNotFoundError:
			
 
				+    print("This example relies on the 'websockets' package.")
			
 
				+    print("Please install it by running: ")
			
 
				+    print()
			
 
				+    print(" $ pip install websockets")
			
 
				+    import sys
			
 
				+
			
 
				+    sys.exit(1)
			
 
				+
			
 
				+from ocpp.routing import on
			
 
				+from ocpp.v16 import ChargePoint as cp
			
 
				+from ocpp.v16 import call_result
			
 
				+from ocpp.v16.enums import Action, RegistrationStatus
			
 
				+
			
 
				+logging.basicConfig(level=logging.INFO)
			
 
				+
			
 
				+
			
 
				+class ChargePoint(cp):
			
 
				+    @on(Action.BootNotification)
			
 
				+    def on_boot_notification(
			
 
				+        self, charge_point_vendor: str, charge_point_model: str, **kwargs
			
 
				+    ):
			
 
				+        return call_result.BootNotificationPayload(
			
 
				+            current_time=datetime.utcnow().isoformat(),
			
 
				+            interval=10,
			
 
				+            status=RegistrationStatus.accepted,
			
 
				+        )
			
 
				+
			
 
				+
			
 
				+async def on_connect(websocket, path):
			
 
				+    """For every new charge point that connects, create a ChargePoint
			
 
				+    instance and start listening for messages.
			
 
				+    """
			
 
				+    try:
			
 
				+        requested_protocols = websocket.request_headers["Sec-WebSocket-Protocol"]
			
 
				+    except KeyError:
			
 
				+        logging.error("Client hasn't requested any Subprotocol. Closing Connection")
			
 
				+        return await websocket.close()
			
 
				+    if websocket.subprotocol:
			
 
				+        logging.info("Protocols Matched: %s", websocket.subprotocol)
			
 
				+    else:
			
 
				+        # In the websockets lib if no subprotocols are supported by the
			
 
				+        # client and the server, it proceeds without a subprotocol,
			
 
				+        # so we have to manually close the connection.
			
 
				+        logging.warning(
			
 
				+            "Protocols Mismatched | Expected Subprotocols: %s,"
			
 
				+            " but client supports  %s | Closing connection",
			
 
				+            websocket.available_subprotocols,
			
 
				+            requested_protocols,
			
 
				+        )
			
 
				+        return await websocket.close()
			
 
				+
			
 
				+    charge_point_id = path.strip("/")
			
 
				+    cp = ChargePoint(charge_point_id, websocket)
			
 
				+
			
 
				+    await cp.start()
			
 
				+
			
 
				+
			
 
				+async def main():
			
 
				+    server = await websockets.serve(
			
 
				+        on_connect, "0.0.0.0", 9000, subprotocols=["ocpp1.6"]
			
 
				+    )
			
 
				+
			
 
				+    logging.info("Server Started listening to new connections...")
			
 
				+    await server.wait_closed()
			
 
				+
			
 
				+
			
 
				+if __name__ == "__main__":
			
 
				+    # asyncio.run() is used when running this example with Python >= 3.7v
			
 
				+    asyncio.run(main())
			
--- a/ocpp/examples/v16/charge_point.py
+++ b/ocpp/examples/v16/charge_point.py
@@ -0,0 +1,47 @@
 
				+import asyncio
			
 
				+import logging
			
 
				+
			
 
				+try:
			
 
				+    import websockets
			
 
				+except ModuleNotFoundError:
			
 
				+    print("This example relies on the 'websockets' package.")
			
 
				+    print("Please install it by running: ")
			
 
				+    print()
			
 
				+    print(" $ pip install websockets")
			
 
				+    import sys
			
 
				+
			
 
				+    sys.exit(1)
			
 
				+
			
 
				+
			
 
				+from ocpp.v16 import ChargePoint as cp
			
 
				+from ocpp.v16 import call
			
 
				+from ocpp.v16.enums import RegistrationStatus
			
 
				+
			
 
				+logging.basicConfig(level=logging.INFO)
			
 
				+
			
 
				+
			
 
				+class ChargePoint(cp):
			
 
				+    async def send_boot_notification(self):
			
 
				+        request = call.BootNotificationPayload(
			
 
				+            charge_point_model="Optimus", charge_point_vendor="The Mobility House"
			
 
				+        )
			
 
				+
			
 
				+        response = await self.call(request)
			
 
				+
			
 
				+        if response.status == RegistrationStatus.accepted:
			
 
				+            print("Connected to central system.")
			
 
				+
			
 
				+
			
 
				+async def main():
			
 
				+    async with websockets.connect(
			
 
				+        "ws://localhost:9000/CP_1", subprotocols=["ocpp1.6"]
			
 
				+    ) as ws:
			
 
				+
			
 
				+        cp = ChargePoint("CP_1", ws)
			
 
				+
			
 
				+        await asyncio.gather(cp.start(), cp.send_boot_notification())
			
 
				+
			
 
				+
			
 
				+if __name__ == "__main__":
			
 
				+    # asyncio.run() is used when running this example with Python >= 3.7v
			
 
				+    asyncio.run(main())
			
--- a/ocpp/examples/v20/central_system.py
+++ b/ocpp/examples/v20/central_system.py
@@ -0,0 +1,78 @@
 
				+import asyncio
			
 
				+import logging
			
 
				+from datetime import datetime
			
 
				+
			
 
				+try:
			
 
				+    import websockets
			
 
				+except ModuleNotFoundError:
			
 
				+    print("This example relies on the 'websockets' package.")
			
 
				+    print("Please install it by running: ")
			
 
				+    print()
			
 
				+    print(" $ pip install websockets")
			
 
				+    import sys
			
 
				+
			
 
				+    sys.exit(1)
			
 
				+
			
 
				+from ocpp.routing import on
			
 
				+from ocpp.v20 import ChargePoint as cp
			
 
				+from ocpp.v20 import call_result
			
 
				+
			
 
				+logging.basicConfig(level=logging.INFO)
			
 
				+
			
 
				+
			
 
				+class ChargePoint(cp):
			
 
				+    @on("BootNotification")
			
 
				+    def on_boot_notification(self, charging_station, reason, **kwargs):
			
 
				+        return call_result.BootNotificationPayload(
			
 
				+            current_time=datetime.utcnow().isoformat(), interval=10, status="Accepted"
			
 
				+        )
			
 
				+
			
 
				+    @on("Heartbeat")
			
 
				+    def on_heartbeat(self):
			
 
				+        print("Got a Heartbeat!")
			
 
				+        return call_result.HeartbeatPayload(
			
 
				+            current_time=datetime.utcnow().strftime("%Y-%m-%dT%H:%M:%S") + "Z"
			
 
				+        )
			
 
				+
			
 
				+
			
 
				+async def on_connect(websocket, path):
			
 
				+    """For every new charge point that connects, create a ChargePoint
			
 
				+    instance and start listening for messages.
			
 
				+    """
			
 
				+    try:
			
 
				+        requested_protocols = websocket.request_headers["Sec-WebSocket-Protocol"]
			
 
				+    except KeyError:
			
 
				+        logging.error("Client hasn't requested any Subprotocol. Closing Connection")
			
 
				+        return await websocket.close()
			
 
				+    if websocket.subprotocol:
			
 
				+        logging.info("Protocols Matched: %s", websocket.subprotocol)
			
 
				+    else:
			
 
				+        # In the websockets lib if no subprotocols are supported by the
			
 
				+        # client and the server, it proceeds without a subprotocol,
			
 
				+        # so we have to manually close the connection.
			
 
				+        logging.warning(
			
 
				+            "Protocols Mismatched | Expected Subprotocols: %s,"
			
 
				+            " but client supports  %s | Closing connection",
			
 
				+            websocket.available_subprotocols,
			
 
				+            requested_protocols,
			
 
				+        )
			
 
				+        return await websocket.close()
			
 
				+
			
 
				+    charge_point_id = path.strip("/")
			
 
				+    cp = ChargePoint(charge_point_id, websocket)
			
 
				+
			
 
				+    await cp.start()
			
 
				+
			
 
				+
			
 
				+async def main():
			
 
				+    server = await websockets.serve(
			
 
				+        on_connect, "0.0.0.0", 9000, subprotocols=["ocpp2.0"]
			
 
				+    )
			
 
				+
			
 
				+    logging.info("Server Started listening to new connections...")
			
 
				+    await server.wait_closed()
			
 
				+
			
 
				+
			
 
				+if __name__ == "__main__":
			
 
				+    # asyncio.run() is used when running this example with Python >= 3.7v
			
 
				+    asyncio.run(main())
			
--- a/ocpp/examples/v20/charge_point.py
+++ b/ocpp/examples/v20/charge_point.py
@@ -0,0 +1,53 @@
 
				+import asyncio
			
 
				+import logging
			
 
				+
			
 
				+try:
			
 
				+    import websockets
			
 
				+except ModuleNotFoundError:
			
 
				+    print("This example relies on the 'websockets' package.")
			
 
				+    print("Please install it by running: ")
			
 
				+    print()
			
 
				+    print(" $ pip install websockets")
			
 
				+    import sys
			
 
				+
			
 
				+    sys.exit(1)
			
 
				+
			
 
				+
			
 
				+from ocpp.v20 import ChargePoint as cp
			
 
				+from ocpp.v20 import call
			
 
				+
			
 
				+logging.basicConfig(level=logging.INFO)
			
 
				+
			
 
				+
			
 
				+class ChargePoint(cp):
			
 
				+    async def send_heartbeat(self, interval):
			
 
				+        request = call.HeartbeatPayload()
			
 
				+        while True:
			
 
				+            await self.call(request)
			
 
				+            await asyncio.sleep(interval)
			
 
				+
			
 
				+    async def send_boot_notification(self):
			
 
				+        request = call.BootNotificationPayload(
			
 
				+            charging_station={"model": "Wallbox XYZ", "vendor_name": "anewone"},
			
 
				+            reason="PowerUp",
			
 
				+        )
			
 
				+        response = await self.call(request)
			
 
				+
			
 
				+        if response.status == "Accepted":
			
 
				+            print("Connected to central system.")
			
 
				+            await self.send_heartbeat(response.interval)
			
 
				+
			
 
				+
			
 
				+async def main():
			
 
				+    async with websockets.connect(
			
 
				+        "ws://localhost:9000/CP_1", subprotocols=["ocpp2.0"]
			
 
				+    ) as ws:
			
 
				+
			
 
				+        cp = ChargePoint("CP_1", ws)
			
 
				+
			
 
				+        await asyncio.gather(cp.start(), cp.send_boot_notification())
			
 
				+
			
 
				+
			
 
				+if __name__ == "__main__":
			
 
				+    # asyncio.run() is used when running this example with Python >= 3.7v
			
 
				+    asyncio.run(main())
			
--- a/ocpp/examples/v201/central_system.py
+++ b/ocpp/examples/v201/central_system.py
@@ -0,0 +1,79 @@
 
				+import asyncio
			
 
				+import logging
			
 
				+from datetime import datetime
			
 
				+
			
 
				+try:
			
 
				+    import websockets
			
 
				+except ModuleNotFoundError:
			
 
				+    print("This example relies on the 'websockets' package.")
			
 
				+    print("Please install it by running: ")
			
 
				+    print()
			
 
				+    print(" $ pip install websockets")
			
 
				+    import sys
			
 
				+
			
 
				+    sys.exit(1)
			
 
				+
			
 
				+from ocpp.routing import on
			
 
				+from ocpp.v201 import ChargePoint as cp
			
 
				+from ocpp.v201 import call_result
			
 
				+
			
 
				+logging.basicConfig(level=logging.INFO)
			
 
				+
			
 
				+
			
 
				+class ChargePoint(cp):
			
 
				+    @on("BootNotification")
			
 
				+    def on_boot_notification(self, charging_station, reason, **kwargs):
			
 
				+        return call_result.BootNotificationPayload(
			
 
				+            current_time=datetime.utcnow().isoformat(), interval=10, status="Accepted"
			
 
				+        )
			
 
				+
			
 
				+    @on("Heartbeat")
			
 
				+    def on_heartbeat(self):
			
 
				+        print("Got a Heartbeat!")
			
 
				+        return call_result.HeartbeatPayload(
			
 
				+            current_time=datetime.utcnow().strftime("%Y-%m-%dT%H:%M:%S") + "Z"
			
 
				+        )
			
 
				+
			
 
				+
			
 
				+async def on_connect(websocket, path):
			
 
				+    """For every new charge point that connects, create a ChargePoint
			
 
				+    instance and start listening for messages.
			
 
				+    """
			
 
				+    try:
			
 
				+        requested_protocols = websocket.request_headers["Sec-WebSocket-Protocol"]
			
 
				+    except KeyError:
			
 
				+        logging.error("Client hasn't requested any Subprotocol. Closing Connection")
			
 
				+        return await websocket.close()
			
 
				+    if websocket.subprotocol:
			
 
				+        logging.info("Protocols Matched: %s", websocket.subprotocol)
			
 
				+    else:
			
 
				+        # In the websockets lib if no subprotocols are supported by the
			
 
				+        # client and the server, it proceeds without a subprotocol,
			
 
				+        # so we have to manually close the connection.
			
 
				+        logging.warning(
			
 
				+            "Protocols Mismatched | Expected Subprotocols: %s,"
			
 
				+            " but client supports %s | Closing connection",
			
 
				+            websocket.available_subprotocols,
			
 
				+            requested_protocols,
			
 
				+        )
			
 
				+        return await websocket.close()
			
 
				+
			
 
				+    charge_point_id = path.strip("/")
			
 
				+    charge_point = ChargePoint(charge_point_id, websocket)
			
 
				+
			
 
				+    await charge_point.start()
			
 
				+
			
 
				+
			
 
				+async def main():
			
 
				+    #  deepcode ignore BindToAllNetworkInterfaces: <Example Purposes>
			
 
				+    server = await websockets.serve(
			
 
				+        on_connect, "0.0.0.0", 9000, subprotocols=["ocpp2.0.1"]
			
 
				+    )
			
 
				+
			
 
				+    logging.info("Server Started listening to new connections...")
			
 
				+    await server.wait_closed()
			
 
				+
			
 
				+
			
 
				+if __name__ == "__main__":
			
 
				+    # asyncio.run() is used when running this example with Python >= 3.7v
			
 
				+    asyncio.run(main())
			
--- a/ocpp/examples/v201/charge_point.py
+++ b/ocpp/examples/v201/charge_point.py
@@ -0,0 +1,54 @@
 
				+import asyncio
			
 
				+import logging
			
 
				+
			
 
				+try:
			
 
				+    import websockets
			
 
				+except ModuleNotFoundError:
			
 
				+    print("This example relies on the 'websockets' package.")
			
 
				+    print("Please install it by running: ")
			
 
				+    print()
			
 
				+    print(" $ pip install websockets")
			
 
				+    import sys
			
 
				+
			
 
				+    sys.exit(1)
			
 
				+
			
 
				+
			
 
				+from ocpp.v201 import ChargePoint as cp
			
 
				+from ocpp.v201 import call
			
 
				+
			
 
				+logging.basicConfig(level=logging.INFO)
			
 
				+
			
 
				+
			
 
				+class ChargePoint(cp):
			
 
				+    async def send_heartbeat(self, interval):
			
 
				+        request = call.HeartbeatPayload()
			
 
				+        while True:
			
 
				+            await self.call(request)
			
 
				+            await asyncio.sleep(interval)
			
 
				+
			
 
				+    async def send_boot_notification(self):
			
 
				+        request = call.BootNotificationPayload(
			
 
				+            charging_station={"model": "Wallbox XYZ", "vendor_name": "anewone"},
			
 
				+            reason="PowerUp",
			
 
				+        )
			
 
				+        response = await self.call(request)
			
 
				+
			
 
				+        if response.status == "Accepted":
			
 
				+            print("Connected to central system.")
			
 
				+            await self.send_heartbeat(response.interval)
			
 
				+
			
 
				+
			
 
				+async def main():
			
 
				+    async with websockets.connect(
			
 
				+        "ws://localhost:9000/CP_1", subprotocols=["ocpp2.0.1"]
			
 
				+    ) as ws:
			
 
				+
			
 
				+        charge_point = ChargePoint("CP_1", ws)
			
 
				+        await asyncio.gather(
			
 
				+            charge_point.start(), charge_point.send_boot_notification()
			
 
				+        )
			
 
				+
			
 
				+
			
 
				+if __name__ == "__main__":
			
 
				+    # asyncio.run() is used when running this example with Python >= 3.7v
			
 
				+    asyncio.run(main())
			
--- a/ocpp/ocpp/__init__.py
+++ b/ocpp/ocpp/__init__.py
--- a/ocpp/ocpp/charge_point.py
+++ b/ocpp/ocpp/charge_point.py
@@ -0,0 +1,368 @@
 
				+import asyncio
			
 
				+import inspect
			
 
				+import logging
			
 
				+import re
			
 
				+import time
			
 
				+import uuid
			
 
				+from dataclasses import asdict
			
 
				+from typing import Dict, List, Union
			
 
				+
			
 
				+from ocpp.exceptions import NotImplementedError, NotSupportedError, OCPPError
			
 
				+from ocpp.messages import Call, MessageType, unpack, validate_payload
			
 
				+from ocpp.routing import create_route_map
			
 
				+
			
 
				+LOGGER = logging.getLogger("ocpp")
			
 
				+
			
 
				+
			
 
				+def camel_to_snake_case(data):
			
 
				+    """
			
 
				+    Convert all keys of all dictionaries inside the given argument from
			
 
				+    camelCase to snake_case.
			
 
				+
			
 
				+    Inspired by: https://stackoverflow.com/a/1176023/1073222
			
 
				+
			
 
				+    """
			
 
				+    if isinstance(data, dict):
			
 
				+        snake_case_dict = {}
			
 
				+        for key, value in data.items():
			
 
				+            s1 = re.sub("(.)([A-Z][a-z]+)", r"\1_\2", key)
			
 
				+            key = re.sub("([a-z0-9])([A-Z])(?=\\S)", r"\1_\2", s1).lower()
			
 
				+
			
 
				+            snake_case_dict[key] = camel_to_snake_case(value)
			
 
				+
			
 
				+        return snake_case_dict
			
 
				+
			
 
				+    if isinstance(data, list):
			
 
				+        snake_case_list = []
			
 
				+        for value in data:
			
 
				+            snake_case_list.append(camel_to_snake_case(value))
			
 
				+
			
 
				+        return snake_case_list
			
 
				+
			
 
				+    return data
			
 
				+
			
 
				+
			
 
				+def snake_to_camel_case(data):
			
 
				+    """
			
 
				+    Convert all keys of all dictionaries inside given argument from
			
 
				+    snake_case to camelCase.
			
 
				+
			
 
				+    Inspired by: https://stackoverflow.com/a/19053800/1073222
			
 
				+    """
			
 
				+    if isinstance(data, dict):
			
 
				+        camel_case_dict = {}
			
 
				+        for key, value in data.items():
			
 
				+            key = key.replace("soc", "SoC")
			
 
				+            key = key.replace("_v2x", "V2X")
			
 
				+            components = key.split("_")
			
 
				+            key = components[0] + "".join(x[:1].upper() + x[1:] for x in components[1:])
			
 
				+            camel_case_dict[key] = snake_to_camel_case(value)
			
 
				+
			
 
				+        return camel_case_dict
			
 
				+
			
 
				+    if isinstance(data, list):
			
 
				+        camel_case_list = []
			
 
				+        for value in data:
			
 
				+            camel_case_list.append(snake_to_camel_case(value))
			
 
				+
			
 
				+        return camel_case_list
			
 
				+
			
 
				+    return data
			
 
				+
			
 
				+
			
 
				+def remove_nones(data: Union[List, Dict]) -> Union[List, Dict]:
			
 
				+    if isinstance(data, dict):
			
 
				+        return {k: remove_nones(v) for k, v in data.items() if v is not None}
			
 
				+
			
 
				+    elif isinstance(data, list):
			
 
				+        return [remove_nones(v) for v in data if v is not None]
			
 
				+
			
 
				+    return data
			
 
				+
			
 
				+
			
 
				+def _raise_key_error(action, version):
			
 
				+    """
			
 
				+    Checks whether a keyerror returned by _handle_call
			
 
				+    is supported by the OCPP version or is simply
			
 
				+    not implemented by the server/client and raises
			
 
				+    the appropriate error.
			
 
				+    """
			
 
				+
			
 
				+    from ocpp.v16.enums import Action as v16_Action
			
 
				+    from ocpp.v201.enums import Action as v201_Action
			
 
				+
			
 
				+    if version == "1.6":
			
 
				+        if hasattr(v16_Action, action):
			
 
				+            raise NotImplementedError(
			
 
				+                details={"cause": f"No handler for {action} registered."}
			
 
				+            )
			
 
				+        else:
			
 
				+            raise NotSupportedError(
			
 
				+                details={"cause": f"{action} not supported by OCPP{version}."}
			
 
				+            )
			
 
				+    elif version in ["2.0", "2.0.1"]:
			
 
				+        if hasattr(v201_Action, action):
			
 
				+            raise NotImplementedError(
			
 
				+                details={"cause": f"No handler for {action} registered."}
			
 
				+            )
			
 
				+        else:
			
 
				+            raise NotSupportedError(
			
 
				+                details={"cause": f"{action} not supported by OCPP{version}."}
			
 
				+            )
			
 
				+
			
 
				+    return
			
 
				+
			
 
				+
			
 
				+class ChargePoint:
			
 
				+    """
			
 
				+    Base Element containing all the necessary OCPP1.6J messages for messages
			
 
				+    initiated and received by the Central System
			
 
				+    """
			
 
				+
			
 
				+    def __init__(self, id, connection, response_timeout=30):
			
 
				+        """
			
 
				+
			
 
				+        Args:
			
 
				+
			
 
				+            charger_id (str): ID of the charger.
			
 
				+            connection: Connection to CP.
			
 
				+            response_timeout (int): When no response on a request is received
			
 
				+                within this interval, a asyncio.TimeoutError is raised.
			
 
				+
			
 
				+        """
			
 
				+        self.id = id
			
 
				+
			
 
				+        # The maximum time in seconds it may take for a CP to respond to a
			
 
				+        # CALL. An asyncio.TimeoutError will be raised if this limit has been
			
 
				+        # exceeded.
			
 
				+        self._response_timeout = response_timeout
			
 
				+
			
 
				+        # A connection to the client. Currently this is an instance of gh
			
 
				+        self._connection = connection
			
 
				+
			
 
				+        # A dictionary that hooks for Actions. So if the CS receives a it will
			
 
				+        # look up the Action into this map and execute the corresponding hooks
			
 
				+        # if exists.
			
 
				+        self.route_map = create_route_map(self)
			
 
				+
			
 
				+        self._call_lock = asyncio.Lock()
			
 
				+
			
 
				+        # A queue used to pass CallResults and CallErrors from
			
 
				+        # the self.serve() task to the self.call() task.
			
 
				+        self._response_queue = asyncio.Queue()
			
 
				+
			
 
				+        # Function used to generate unique ids for CALLs. By default
			
 
				+        # uuid.uuid4() is used, but it can be changed. This is meant primarily
			
 
				+        # for testing purposes to have predictable unique ids.
			
 
				+        self._unique_id_generator = uuid.uuid4
			
 
				+
			
 
				+    async def start(self):
			
 
				+        while True:
			
 
				+            message = await self._connection.recv()
			
 
				+            LOGGER.info("%s: receive message %s", self.id, message)
			
 
				+
			
 
				+            await self.route_message(message)
			
 
				+
			
 
				+    async def route_message(self, raw_msg):
			
 
				+        """
			
 
				+        Route a message received from a CP.
			
 
				+
			
 
				+        If the message is a of type Call the corresponding hooks are executed.
			
 
				+        If the message is of type CallResult or CallError the message is passed
			
 
				+        to the call() function via the response_queue.
			
 
				+        """
			
 
				+        try:
			
 
				+            msg = unpack(raw_msg)
			
 
				+        except OCPPError as e:
			
 
				+            LOGGER.exception(
			
 
				+                "Unable to parse message: '%s', it doesn't seem "
			
 
				+                "to be valid OCPP: %s",
			
 
				+                raw_msg,
			
 
				+                e,
			
 
				+            )
			
 
				+            return
			
 
				+
			
 
				+        if msg.message_type_id == MessageType.Call:
			
 
				+            try:
			
 
				+                await self._handle_call(msg)
			
 
				+            except OCPPError as error:
			
 
				+                LOGGER.exception("Error while handling request '%s'", msg)
			
 
				+                response = msg.create_call_error(error).to_json()
			
 
				+                await self._send(response)
			
 
				+
			
 
				+        elif msg.message_type_id in [MessageType.CallResult, MessageType.CallError]:
			
 
				+            self._response_queue.put_nowait(msg)
			
 
				+
			
 
				+    async def _handle_call(self, msg):
			
 
				+        """
			
 
				+        Execute all hooks installed for based on the Action of the message.
			
 
				+
			
 
				+        First the '_on_action' hook is executed and its response is returned to
			
 
				+        the client. If there is no '_on_action' hook for Action in the message
			
 
				+        a CallError with a NotImplementedError is returned. If the Action is
			
 
				+        not supported by the OCPP version a NotSupportedError is returned.
			
 
				+
			
 
				+        Next the '_after_action' hook is executed.
			
 
				+
			
 
				+        """
			
 
				+        try:
			
 
				+            handlers = self.route_map[msg.action]
			
 
				+        except KeyError:
			
 
				+            _raise_key_error(msg.action, self._ocpp_version)
			
 
				+            return
			
 
				+
			
 
				+        if not handlers.get("_skip_schema_validation", False):
			
 
				+            validate_payload(msg, self._ocpp_version)
			
 
				+        # OCPP uses camelCase for the keys in the payload. It's more pythonic
			
 
				+        # to use snake_case for keyword arguments. Therefore the keys must be
			
 
				+        # 'translated'. Some examples:
			
 
				+        #
			
 
				+        # * chargePointVendor becomes charge_point_vendor
			
 
				+        # * firmwareVersion becomes firmwareVersion
			
 
				+        if msg.payload is None:
			
 
				+            msg.payload = {}
			
 
				+        snake_case_payload = camel_to_snake_case(msg.payload)
			
 
				+
			
 
				+        try:
			
 
				+            handler = handlers["_on_action"]
			
 
				+        except KeyError:
			
 
				+            _raise_key_error(msg.action, self._ocpp_version)
			
 
				+
			
 
				+        try:
			
 
				+        
			
 
				+            response = handler(**snake_case_payload)
			
 
				+            if inspect.isawaitable(response):
			
 
				+                response = await response
			
 
				+        except Exception as e:
			
 
				+            LOGGER.exception("Error while handling request '%s'", msg)
			
 
				+            response = msg.create_call_error(e).to_json()
			
 
				+            await self._send(response)
			
 
				+
			
 
				+            return
			
 
				+
			
 
				+        temp_response_payload = asdict(response)
			
 
				+
			
 
				+        # Remove nones ensures that we strip out optional arguments
			
 
				+        # which were not set and have a default value of None
			
 
				+        response_payload = remove_nones(temp_response_payload)
			
 
				+
			
 
				+        # The response payload must be 'translated' from snake_case to
			
 
				+        # camelCase. So:
			
 
				+        #
			
 
				+        # * charge_point_vendor becomes chargePointVendor
			
 
				+        # * firmware_version becomes firmwareVersion
			
 
				+        camel_case_payload = snake_to_camel_case(response_payload)
			
 
				+
			
 
				+        response = msg.create_call_result(camel_case_payload)
			
 
				+
			
 
				+        if not handlers.get("_skip_schema_validation", False):
			
 
				+            validate_payload(response, self._ocpp_version)
			
 
				+
			
 
				+        await self._send(response.to_json())
			
 
				+
			
 
				+        try:
			
 
				+            handler = handlers["_after_action"]
			
 
				+            # Create task to avoid blocking when making a call inside the
			
 
				+            # after handler
			
 
				+            response = handler(**snake_case_payload)
			
 
				+            if inspect.isawaitable(response):
			
 
				+                asyncio.ensure_future(response)
			
 
				+        except KeyError:
			
 
				+            # '_on_after' hooks are not required. Therefore ignore exception
			
 
				+            # when no '_on_after' hook is installed.
			
 
				+            pass
			
 
				+        return response
			
 
				+
			
 
				+    async def call(self, payload, suppress=True, unique_id=None):
			
 
				+        """
			
 
				+        Send Call message to client and return payload of response.
			
 
				+
			
 
				+        The given payload is transformed into a Call object by looking at the
			
 
				+        type of the payload. A payload of type BootNotificationPayload will
			
 
				+        turn in a Call with Action BootNotification, a HeartbeatPayload will
			
 
				+        result in a Call with Action Heartbeat etc.
			
 
				+
			
 
				+        A timeout is raised when no response has arrived before expiring of
			
 
				+        the configured timeout.
			
 
				+
			
 
				+        When waiting for a response no other Call message can be send. So this
			
 
				+        function will wait before response arrives or response timeout has
			
 
				+        expired. This is in line the OCPP specification
			
 
				+
			
 
				+        Suppress is used to maintain backwards compatibility. When set to True,
			
 
				+        if response is a CallError, then this call will be suppressed. When
			
 
				+        set to False, an exception will be raised for users to handle this
			
 
				+        CallError.
			
 
				+
			
 
				+        """
			
 
				+        camel_case_payload = snake_to_camel_case(asdict(payload))
			
 
				+
			
 
				+        unique_id = (
			
 
				+            unique_id if unique_id is not None else str(self._unique_id_generator())
			
 
				+        )
			
 
				+
			
 
				+        call = Call(
			
 
				+            unique_id=unique_id,
			
 
				+            action=payload.__class__.__name__[:-7],
			
 
				+            payload=remove_nones(camel_case_payload),
			
 
				+        )
			
 
				+
			
 
				+        validate_payload(call, self._ocpp_version)
			
 
				+
			
 
				+        # Use a lock to prevent make sure that only 1 message can be send at a
			
 
				+        # a time.
			
 
				+        async with self._call_lock:
			
 
				+            await self._send(call.to_json())
			
 
				+            try:
			
 
				+                response = await self._get_specific_response(
			
 
				+                    call.unique_id, self._response_timeout
			
 
				+                )
			
 
				+            except asyncio.TimeoutError:
			
 
				+                raise asyncio.TimeoutError(
			
 
				+                    f"Waited {self._response_timeout}s for response on "
			
 
				+                    f"{call.to_json()}."
			
 
				+                )
			
 
				+
			
 
				+        if response.message_type_id == MessageType.CallError:
			
 
				+            LOGGER.warning("Received a CALLError: %s'", response)
			
 
				+            if suppress:
			
 
				+                return
			
 
				+            raise response.to_exception()
			
 
				+        else:
			
 
				+            response.action = call.action
			
 
				+            validate_payload(response, self._ocpp_version)
			
 
				+
			
 
				+        snake_case_payload = camel_to_snake_case(response.payload)
			
 
				+        # Create the correct Payload instance based on the received payload. If
			
 
				+        # this method is called with a call.BootNotificationPayload, then it
			
 
				+        # will create a call_result.BootNotificationPayload. If this method is
			
 
				+        # called with a call.HeartbeatPayload, then it will create a
			
 
				+        # call_result.HeartbeatPayload etc.
			
 
				+        cls = getattr(self._call_result, payload.__class__.__name__)  # noqa
			
 
				+        return cls(**snake_case_payload)
			
 
				+
			
 
				+    async def _get_specific_response(self, unique_id, timeout):
			
 
				+        """
			
 
				+        Return response with given unique ID or raise an asyncio.TimeoutError.
			
 
				+        """
			
 
				+        wait_until = time.time() + timeout
			
 
				+        try:
			
 
				+            # Wait for response of the Call message.
			
 
				+            response = await asyncio.wait_for(self._response_queue.get(), timeout)
			
 
				+        except asyncio.TimeoutError:
			
 
				+            raise
			
 
				+
			
 
				+        if response.unique_id == unique_id:
			
 
				+            return response
			
 
				+
			
 
				+        LOGGER.error("Ignoring response with unknown unique id: %s", response)
			
 
				+        timeout_left = wait_until - time.time()
			
 
				+
			
 
				+        if timeout_left < 0:
			
 
				+            raise asyncio.TimeoutError
			
 
				+
			
 
				+        return await self._get_specific_response(unique_id, timeout_left)
			
 
				+
			
 
				+    async def _send(self, message):
			
 
				+        LOGGER.info("%s: send %s", self.id, message)
			
 
				+        await self._connection.send(message)
			
--- a/ocpp/ocpp/exceptions.py
+++ b/ocpp/ocpp/exceptions.py
@@ -0,0 +1,163 @@
 
				+class OCPPError(Exception):
			
 
				+    """Base class for all OCPP errors. It shouldn't be raised, only it
			
 
				+    subclasses.
			
 
				+    """
			
 
				+
			
 
				+    default_description = ""
			
 
				+
			
 
				+    def __init__(self, description=None, details=None):
			
 
				+        self.description = description
			
 
				+        if description is None:
			
 
				+            self.description = self.default_description
			
 
				+
			
 
				+        self.details = details
			
 
				+        if self.details is None:
			
 
				+            self.details = {}
			
 
				+
			
 
				+    def __eq__(self, other):
			
 
				+        if other.__class__ is self.__class__:
			
 
				+            return (self.description, self.details) == (
			
 
				+                other.description,
			
 
				+                other.details,
			
 
				+            )
			
 
				+
			
 
				+        return NotImplemented
			
 
				+
			
 
				+    def __repr__(self):
			
 
				+        return (
			
 
				+            f"<{self.__class__.__name__} - description={self.description},"
			
 
				+            f" details={self.details}>"
			
 
				+        )
			
 
				+
			
 
				+    def __str__(self):
			
 
				+        return f"{self.__class__.__name__}: {self.description}," f" {self.details}"
			
 
				+
			
 
				+
			
 
				+class NotImplementedError(OCPPError):
			
 
				+    code = "NotImplemented"
			
 
				+    default_description = (
			
 
				+        "Request Action is recognized but not supported by the receiver"
			
 
				+    )
			
 
				+
			
 
				+
			
 
				+class NotSupportedError(OCPPError):
			
 
				+    code = "NotSupported"
			
 
				+    default_description = "Requested Action is not known by receiver"
			
 
				+
			
 
				+
			
 
				+class InternalError(OCPPError):
			
 
				+    code = "InternalError"
			
 
				+    default_description = (
			
 
				+        "An internal error occurred and the receiver was "
			
 
				+        "able to process the requested Action successfully"
			
 
				+    )
			
 
				+
			
 
				+
			
 
				+class ProtocolError(OCPPError):
			
 
				+    code = "ProtocolError"
			
 
				+    default_description = "Payload for Action is incomplete"
			
 
				+
			
 
				+
			
 
				+class SecurityError(OCPPError):
			
 
				+    code = "SecurityError"
			
 
				+    default_description = (
			
 
				+        "During the processing of Action a security issue "
			
 
				+        "occurred preventing receiver from completing the "
			
 
				+        "Action successfully"
			
 
				+    )
			
 
				+
			
 
				+
			
 
				+class FormatViolationError(OCPPError):
			
 
				+    """
			
 
				+    Not strict OCPP 1.6 - see FormationViolationError
			
 
				+    Valid OCPP 2.0.1
			
 
				+    """
			
 
				+
			
 
				+    code = "FormatViolation"
			
 
				+    default_description = (
			
 
				+        "Payload for Action is syntactically incorrect or " "structure for Action"
			
 
				+    )
			
 
				+
			
 
				+
			
 
				+class FormationViolationError(OCPPError):
			
 
				+    """
			
 
				+    To allow for strict OCPP 1.6 compliance
			
 
				+        5. Known issues that will not be fixed
			
 
				+        5.2. Page 14, par 4.2.3. CallError: incorrect name in enum: FormationViolation
			
 
				+        Incorrect name in enum: FormationViolation
			
 
				+    """
			
 
				+
			
 
				+    code = "FormationViolation"
			
 
				+    default_description = (
			
 
				+        "Payload for Action is syntactically incorrect or structure for Action"
			
 
				+    )
			
 
				+
			
 
				+
			
 
				+class PropertyConstraintViolationError(OCPPError):
			
 
				+    code = "PropertyConstraintViolation"
			
 
				+    default_description = (
			
 
				+        "Payload is syntactically correct but at least "
			
 
				+        "one field contains an invalid value"
			
 
				+    )
			
 
				+
			
 
				+
			
 
				+class OccurenceConstraintViolationError(OCPPError):
			
 
				+    """
			
 
				+    To allow for strict OCPP 1.6 compliance
			
 
				+    ocpp-j-1.6-errata-sheet.pdf
			
 
				+        5. Known issues that will not be fixed
			
 
				+        5.1. Page 14, par 4.2.3: CallError: Typo in enum
			
 
				+        Typo in enum: OccurenceConstraintViolation
			
 
				+    Valid in 2.0.1
			
 
				+    """
			
 
				+
			
 
				+    code = "OccurenceConstraintViolation"
			
 
				+    default_description = (
			
 
				+        "Payload for Action is syntactically correct but "
			
 
				+        "at least one of the fields violates occurence "
			
 
				+        "constraints"
			
 
				+    )
			
 
				+
			
 
				+
			
 
				+class OccurrenceConstraintViolationError(OCPPError):
			
 
				+    """
			
 
				+    Not strict OCPP 1.6 - see OccurenceConstraintViolationError
			
 
				+    Not valid OCPP 2.0.1
			
 
				+    Valid in OCPP 2.1
			
 
				+    """
			
 
				+
			
 
				+    code = "OccurrenceConstraintViolation"
			
 
				+    default_description = (
			
 
				+        "Payload for Action is syntactically correct but "
			
 
				+        "at least one of the fields violates occurence "
			
 
				+        "constraints"
			
 
				+    )
			
 
				+
			
 
				+
			
 
				+class TypeConstraintViolationError(OCPPError):
			
 
				+    code = "TypeConstraintViolation"
			
 
				+    default_description = (
			
 
				+        "Payload for Action is syntactically correct but "
			
 
				+        "at least one of the fields violates data type "
			
 
				+        "constraints (e.g. “somestring”: 12)"
			
 
				+    )
			
 
				+
			
 
				+
			
 
				+class GenericError(OCPPError):
			
 
				+    code = "GenericError"
			
 
				+    default_description = "Any other error not all other OCPP defined errors"
			
 
				+
			
 
				+
			
 
				+class ValidationError(Exception):
			
 
				+    """ValidationError should be raised if validation a message payload fails.
			
 
				+
			
 
				+    Note this isn't an official OCPP error!
			
 
				+    """
			
 
				+
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+class UnknownCallErrorCodeError(Exception):
			
 
				+    """Raised when a CALLERROR is received with unknown error code."""
			
 
				+
			
 
				+    pass
			
--- a/ocpp/ocpp/messages.py
+++ b/ocpp/ocpp/messages.py
@@ -0,0 +1,450 @@
 
				+""" Module containing classes that model the several OCPP messages types. It
			
 
				+also contain some helper functions for packing and unpacking messages.  """
			
 
				+from __future__ import annotations
			
 
				+
			
 
				+import decimal
			
 
				+import json
			
 
				+import os
			
 
				+from dataclasses import asdict, is_dataclass
			
 
				+from typing import Callable, Dict, Union
			
 
				+
			
 
				+from jsonschema import Draft4Validator
			
 
				+from jsonschema.exceptions import ValidationError as SchemaValidationError
			
 
				+
			
 
				+from ocpp.exceptions import (
			
 
				+    FormatViolationError,
			
 
				+    NotImplementedError,
			
 
				+    OCPPError,
			
 
				+    PropertyConstraintViolationError,
			
 
				+    ProtocolError,
			
 
				+    TypeConstraintViolationError,
			
 
				+    UnknownCallErrorCodeError,
			
 
				+    ValidationError,
			
 
				+)
			
 
				+
			
 
				+_validators: Dict[str, Draft4Validator] = {}
			
 
				+
			
 
				+
			
 
				+class _DecimalEncoder(json.JSONEncoder):
			
 
				+    """Encode values of type `decimal.Decimal` using 1 decimal point.
			
 
				+
			
 
				+    A custom encoder is required because `json.dumps()` cannot encode a value
			
 
				+    of type decimal.Decimal. This raises a TypeError:
			
 
				+
			
 
				+        >>> import decimal
			
 
				+        >>> import json
			
 
				+        >>> >>> json.dumps(decimal.Decimal(3))
			
 
				+        Traceback (most recent call last):
			
 
				+          File "<stdin>", line 1, in <module>
			
 
				+          File "/home/developer/.pyenv/versions/3.7.0/lib/python3.7/json/__init__.py", line 231, in dumps  # noqa
			
 
				+            return _default_encoder.encode(obj)
			
 
				+          File "/home/developer/.pyenv/versions/3.7.0/lib/python3.7/json/encoder.py", line 199, in encode
			
 
				+            chunks = self.iterencode(o, _one_shot=True)
			
 
				+          File "/home/developer/.pyenv/versions/3.7.0/lib/python3.7/json/encoder.py", line 257, in iterencode
			
 
				+            return _iterencode(o, 0)
			
 
				+          File "/home/developer/.pyenv/versions/3.7.0/lib/python3.7/json/encoder.py", line 179, in default
			
 
				+            raise TypeError(f'Object of type {o.__class__.__name__} '
			
 
				+        TypeError: Object of type Decimal is not JSON serializable
			
 
				+
			
 
				+    This can be prevented by using a custom encoder.
			
 
				+
			
 
				+    """
			
 
				+
			
 
				+    def default(self, obj):
			
 
				+        if isinstance(obj, decimal.Decimal):
			
 
				+            return float("%.1f" % obj)
			
 
				+        try:
			
 
				+            return json.JSONEncoder.default(self, obj)
			
 
				+        except TypeError as e:
			
 
				+            try:
			
 
				+                return obj.to_json()
			
 
				+            except AttributeError:
			
 
				+                raise e
			
 
				+
			
 
				+
			
 
				+class MessageType:
			
 
				+    """Number identifying the different types of OCPP messages."""
			
 
				+
			
 
				+    #: Call identifies a request.
			
 
				+    Call = 2
			
 
				+
			
 
				+    #: CallResult identifies a successful response.
			
 
				+    CallResult = 3
			
 
				+
			
 
				+    #: CallError identifies an erroneous response.
			
 
				+    CallError = 4
			
 
				+
			
 
				+
			
 
				+def unpack(msg):
			
 
				+    """
			
 
				+    Unpacks a message into either a Call, CallError or CallResult.
			
 
				+    """
			
 
				+    try:
			
 
				+        msg = json.loads(msg)
			
 
				+    except json.JSONDecodeError:
			
 
				+        raise FormatViolationError(
			
 
				+            details={"cause": "Message is not valid JSON", "ocpp_message": msg}
			
 
				+        )
			
 
				+
			
 
				+    if not isinstance(msg, list):
			
 
				+        raise ProtocolError(
			
 
				+            details={
			
 
				+                "cause": (
			
 
				+                    "OCPP message hasn't the correct format. It "
			
 
				+                    f"should be a list, but got '{type(msg)}' "
			
 
				+                    "instead"
			
 
				+                )
			
 
				+            }
			
 
				+        )
			
 
				+
			
 
				+    for cls in [Call, CallResult, CallError]:
			
 
				+        try:
			
 
				+            if msg[0] == cls.message_type_id:
			
 
				+                return cls(*msg[1:])
			
 
				+        except IndexError:
			
 
				+            raise ProtocolError(
			
 
				+                details={"cause": "Message does not contain MessageTypeId"}
			
 
				+            )
			
 
				+        except TypeError:
			
 
				+            raise ProtocolError(details={"cause": "Message is missing elements."})
			
 
				+
			
 
				+    raise PropertyConstraintViolationError(
			
 
				+        details={"cause": f"MessageTypeId '{msg[0]}' isn't valid"}
			
 
				+    )
			
 
				+
			
 
				+
			
 
				+def pack(msg):
			
 
				+    """
			
 
				+    Returns the JSON representation of a Call, CallError or CallResult.
			
 
				+
			
 
				+    It just calls the 'to_json()' method of the message. But it is here mainly
			
 
				+    to complement the 'unpack' function of this module.
			
 
				+    """
			
 
				+    return msg.to_json()
			
 
				+
			
 
				+
			
 
				+def get_validator(
			
 
				+    message_type_id: int, action: str, ocpp_version: str, parse_float: Callable = float
			
 
				+) -> Draft4Validator:
			
 
				+    """
			
 
				+    Read schema from disk and return as `Draft4Validator`. Instances will be
			
 
				+    cached for performance reasons.
			
 
				+
			
 
				+    The `parse_float` argument can be used to set the conversion method that
			
 
				+    is used to parse floats. It must be a callable taking 1 argument. By
			
 
				+    default it is `float()`, but certain schema's require `decimal.Decimal()`.
			
 
				+    """
			
 
				+    if ocpp_version not in ["1.6", "2.0", "2.0.1"]:
			
 
				+        raise ValueError
			
 
				+
			
 
				+    schemas_dir = "v" + ocpp_version.replace(".", "")
			
 
				+
			
 
				+    schema_name = action
			
 
				+    if message_type_id == MessageType.CallResult:
			
 
				+        schema_name += "Response"
			
 
				+    elif message_type_id == MessageType.Call:
			
 
				+        if ocpp_version in ["2.0", "2.0.1"]:
			
 
				+            schema_name += "Request"
			
 
				+
			
 
				+    if ocpp_version == "2.0":
			
 
				+        schema_name += "_v1p0"
			
 
				+
			
 
				+    cache_key = schema_name + "_" + ocpp_version
			
 
				+    if cache_key in _validators:
			
 
				+        return _validators[cache_key]
			
 
				+
			
 
				+    dir, _ = os.path.split(os.path.realpath(__file__))
			
 
				+    relative_path = f"{schemas_dir}/schemas/{schema_name}.json"
			
 
				+    path = os.path.join(dir, relative_path)
			
 
				+
			
 
				+    # The JSON schemas for OCPP 2.0 start with a byte order mark (BOM)
			
 
				+    # character. If no encoding is given, reading the schema would fail with:
			
 
				+    #
			
 
				+    #     Unexpected UTF-8 BOM (decode using utf-8-sig):
			
 
				+    with open(path, "r", encoding="utf-8-sig") as f:
			
 
				+        data = f.read()
			
 
				+        validator = Draft4Validator(json.loads(data, parse_float=parse_float))
			
 
				+        _validators[cache_key] = validator
			
 
				+
			
 
				+    return _validators[cache_key]
			
 
				+
			
 
				+
			
 
				+def validate_payload(message: Union[Call, CallResult], ocpp_version: str) -> None:
			
 
				+    """Validate the payload of the message using JSON schemas."""
			
 
				+    if type(message) not in [Call, CallResult]:
			
 
				+        raise ValidationError(
			
 
				+            "Payload can't be validated because message "
			
 
				+            f"type. It's '{type(message)}', but it should "
			
 
				+            "be either 'Call'  or 'CallResult'."
			
 
				+        )
			
 
				+
			
 
				+    try:
			
 
				+        # 3 OCPP 1.6 schedules have fields of type floats. The JSON schema
			
 
				+        # defines a certain precision for these fields of 1 decimal. A value of
			
 
				+        # 21.4 is valid, whereas a value if 4.11 is not.
			
 
				+        #
			
 
				+        # The problem is that Python's internal representation of 21.4 might
			
 
				+        # have more than 1 decimal. It might be 21.399999999999995. This would
			
 
				+        # make the validation fail, although the payload is correct. This is a
			
 
				+        # known issue with jsonschemas, see:
			
 
				+        # https://github.com/Julian/jsonschema/issues/247
			
 
				+        #
			
 
				+        # This issue can be fixed by using a different parser for floats than
			
 
				+        # the default one that is used.
			
 
				+        #
			
 
				+        # Both the schema and the payload must be parsed using the different
			
 
				+        # parser for floats.
			
 
				+        if ocpp_version == "1.6" and (
			
 
				+            (
			
 
				+                type(message) == Call
			
 
				+                and message.action in ["SetChargingProfile", "RemoteStartTransaction"]
			
 
				+            )  # noqa
			
 
				+            or (
			
 
				+                type(message) == CallResult and message.action == "GetCompositeSchedule"
			
 
				+            )
			
 
				+        ):
			
 
				+            validator = get_validator(
			
 
				+                message.message_type_id,
			
 
				+                message.action,
			
 
				+                ocpp_version,
			
 
				+                parse_float=decimal.Decimal,
			
 
				+            )
			
 
				+
			
 
				+            message.payload = json.loads(
			
 
				+                json.dumps(message.payload), parse_float=decimal.Decimal
			
 
				+            )
			
 
				+        else:
			
 
				+            validator = get_validator(
			
 
				+                message.message_type_id, message.action, ocpp_version
			
 
				+            )
			
 
				+    except (OSError, json.JSONDecodeError):
			
 
				+        raise NotImplementedError(
			
 
				+            details={"cause": f"Failed to validate action: {message.action}"}
			
 
				+        )
			
 
				+
			
 
				+    try:
			
 
				+        validator.validate(message.payload)
			
 
				+    except SchemaValidationError as e:
			
 
				+        if e.validator == "type":
			
 
				+            raise TypeConstraintViolationError(
			
 
				+                details={"cause": e.message, "ocpp_message": message}
			
 
				+            )
			
 
				+        elif e.validator == "additionalProperties":
			
 
				+            raise FormatViolationError(
			
 
				+                details={"cause": e.message, "ocpp_message": message}
			
 
				+            )
			
 
				+        elif e.validator == "required":
			
 
				+            raise ProtocolError(details={"cause": e.message})
			
 
				+
			
 
				+        elif e.validator == "maxLength":
			
 
				+            raise TypeConstraintViolationError(
			
 
				+                details={"cause": e.message, "ocpp_message": message}
			
 
				+            ) from e
			
 
				+        else:
			
 
				+            raise FormatViolationError(
			
 
				+                details={
			
 
				+                    "cause": f"Payload '{message.payload}' for action "
			
 
				+                    f"'{message.action}' is not valid: {e}",
			
 
				+                    "ocpp_message": message,
			
 
				+                }
			
 
				+            )
			
 
				+
			
 
				+
			
 
				+class Call:
			
 
				+    """A Call is a type of message that initiate a request/response sequence.
			
 
				+    Both central systems and charge points can send this message.
			
 
				+
			
 
				+    From the specification:
			
 
				+
			
 
				+        A Call always consists of 4 elements: The standard elements
			
 
				+        MessageTypeId and UniqueId, a specific Action that is required on the
			
 
				+        other side and a payload, the arguments to the Action. The syntax of a
			
 
				+        call looks like this:
			
 
				+
			
 
				+            [<MessageTypeId>, "<UniqueId>", "<Action>", {<Payload>}]
			
 
				+
			
 
				+        ...
			
 
				+
			
 
				+        For example, a BootNotification request could look like this:
			
 
				+
			
 
				+            [2,
			
 
				+             "19223201",
			
 
				+             "BootNotification",
			
 
				+             {
			
 
				+              "chargePointVendor": "VendorX",
			
 
				+              "chargePointModel": "SingleSocketCharger"
			
 
				+             }
			
 
				+            ]
			
 
				+    """
			
 
				+
			
 
				+    message_type_id = 2
			
 
				+
			
 
				+    def __init__(self, unique_id, action, payload):
			
 
				+        self.unique_id = unique_id
			
 
				+        self.action = action
			
 
				+        self.payload = payload
			
 
				+
			
 
				+        if is_dataclass(payload):
			
 
				+            self.payload = asdict(payload)
			
 
				+
			
 
				+    def to_json(self):
			
 
				+        """Return a valid JSON representation of the instance."""
			
 
				+        return json.dumps(
			
 
				+            [
			
 
				+                self.message_type_id,
			
 
				+                self.unique_id,
			
 
				+                self.action,
			
 
				+                self.payload,
			
 
				+            ],
			
 
				+            # By default json.dumps() adds a white space after every separator.
			
 
				+            # By setting the separator manually that can be avoided.
			
 
				+            separators=(",", ":"),
			
 
				+            cls=_DecimalEncoder,
			
 
				+        )
			
 
				+
			
 
				+    def create_call_result(self, payload):
			
 
				+        call_result = CallResult(self.unique_id, payload)
			
 
				+        call_result.action = self.action
			
 
				+        return call_result
			
 
				+
			
 
				+    def create_call_error(self, exception):
			
 
				+        error_code = "InternalError"
			
 
				+        error_description = "An unexpected error occurred."
			
 
				+        error_details = {}
			
 
				+
			
 
				+        if isinstance(exception, OCPPError):
			
 
				+            error_code = exception.code
			
 
				+            error_description = exception.description
			
 
				+            error_details = exception.details
			
 
				+
			
 
				+        return CallError(
			
 
				+            self.unique_id,
			
 
				+            error_code,
			
 
				+            error_description,
			
 
				+            error_details,
			
 
				+        )
			
 
				+
			
 
				+    def __repr__(self):
			
 
				+        return (
			
 
				+            f"<Call - unique_id={self.unique_id}, action={self.action}, "
			
 
				+            f"payload={self.payload}>"
			
 
				+        )
			
 
				+
			
 
				+
			
 
				+class CallResult:
			
 
				+    """
			
 
				+    A CallResult is a message indicating that a Call has been handled
			
 
				+    successfully.
			
 
				+
			
 
				+    From the specification:
			
 
				+
			
 
				+        A CallResult always consists of 3 elements: The standard elements
			
 
				+        MessageTypeId, UniqueId and a payload, containing the response to the
			
 
				+        Action in the original Call. The syntax of a call looks like this:
			
 
				+
			
 
				+            [<MessageTypeId>, "<UniqueId>", {<Payload>}]
			
 
				+
			
 
				+        ...
			
 
				+
			
 
				+        For example, a BootNotification response could look like this:
			
 
				+
			
 
				+            [3,
			
 
				+             "19223201",
			
 
				+             {
			
 
				+              "status":"Accepted",
			
 
				+              "currentTime":"2013-02-01T20:53:32.486Z",
			
 
				+              "heartbeatInterval":300
			
 
				+             }
			
 
				+            ]
			
 
				+
			
 
				+    """
			
 
				+
			
 
				+    message_type_id = 3
			
 
				+
			
 
				+    def __init__(self, unique_id, payload, action=None):
			
 
				+        self.unique_id = unique_id
			
 
				+        self.payload = payload
			
 
				+
			
 
				+        # Strictly speaking no action is required in a CallResult. But in order
			
 
				+        # to validate the message it is needed.
			
 
				+        self.action = action
			
 
				+
			
 
				+    def to_json(self):
			
 
				+        return json.dumps(
			
 
				+            [
			
 
				+                self.message_type_id,
			
 
				+                self.unique_id,
			
 
				+                self.payload,
			
 
				+            ],
			
 
				+            # By default json.dumps() adds a white space after every separator.
			
 
				+            # By setting the separator manually that can be avoided.
			
 
				+            separators=(",", ":"),
			
 
				+            cls=_DecimalEncoder,
			
 
				+        )
			
 
				+
			
 
				+    def __repr__(self):
			
 
				+        return (
			
 
				+            f"<CallResult - unique_id={self.unique_id}, "
			
 
				+            f"action={self.action}, "
			
 
				+            f"payload={self.payload}>"
			
 
				+        )
			
 
				+
			
 
				+
			
 
				+class CallError:
			
 
				+    """
			
 
				+    A CallError is a response to a Call that indicates an error.
			
 
				+
			
 
				+    From the specification:
			
 
				+
			
 
				+        CallError always consists of 5 elements: The standard elements
			
 
				+        MessageTypeId and UniqueId, an errorCode string, an errorDescription
			
 
				+        string and an errorDetails object.
			
 
				+
			
 
				+        The syntax of a call looks like this:
			
 
				+
			
 
				+            [<MessageTypeId>, "<UniqueId>", "<errorCode>", "<errorDescription>", {<errorDetails>}] # noqa
			
 
				+    """
			
 
				+
			
 
				+    message_type_id = 4
			
 
				+
			
 
				+    def __init__(self, unique_id, error_code, error_description, error_details=None):
			
 
				+        self.unique_id = unique_id
			
 
				+        self.error_code = error_code
			
 
				+        self.error_description = error_description
			
 
				+        self.error_details = error_details
			
 
				+
			
 
				+    def to_json(self):
			
 
				+        return json.dumps(
			
 
				+            [
			
 
				+                self.message_type_id,
			
 
				+                self.unique_id,
			
 
				+                self.error_code,
			
 
				+                self.error_description,
			
 
				+                self.error_details,
			
 
				+            ],
			
 
				+            # By default json.dumps() adds a white space after every separator.
			
 
				+            # By setting the separator manually that can be avoided.
			
 
				+            separators=(",", ":"),
			
 
				+            cls=_DecimalEncoder,
			
 
				+        )
			
 
				+
			
 
				+    def to_exception(self):
			
 
				+        """Return the exception that corresponds to the CallError."""
			
 
				+        for error in OCPPError.__subclasses__():
			
 
				+            if error.code == self.error_code:
			
 
				+                return error(
			
 
				+                    description=self.error_description, details=self.error_details
			
 
				+                )
			
 
				+
			
 
				+        raise UnknownCallErrorCodeError(
			
 
				+            f"Error code '{self.error_code}' is not defined by the"
			
 
				+            " OCPP specification"
			
 
				+        )
			
 
				+
			
 
				+    def __repr__(self):
			
 
				+        return (
			
 
				+            f"<CallError - unique_id={self.unique_id}, "
			
 
				+            f"error_code={self.error_code}, "
			
 
				+            f"error_description={self.error_description}, "
			
 
				+            f"error_details={self.error_details}>"
			
 
				+        )
			
--- a/ocpp/ocpp/routing.py
+++ b/ocpp/ocpp/routing.py
@@ -0,0 +1,139 @@
 
				+import functools
			
 
				+
			
 
				+routables = []
			
 
				+
			
 
				+
			
 
				+def on(action, *, skip_schema_validation=False):
			
 
				+    """
			
 
				+    Function decorator to mark function as handler for specific action. The
			
 
				+    wrapped function may be async or sync.
			
 
				+
			
 
				+    The handler function will receive keyword arguments derived from the
			
 
				+    payload of the specific action. It's recommended you use `**kwargs` in your
			
 
				+    definition to ignore any extra arguments that may be added in the future.
			
 
				+
			
 
				+    The handler function should return a relevant payload to be returned to the
			
 
				+    Charge Point.
			
 
				+
			
 
				+    It can be used like so:
			
 
				+
			
 
				+    ```
			
 
				+    class MyChargePoint(cp):
			
 
				+        @on(Action.BootNotification):
			
 
				+        async def on_boot_notification(
			
 
				+            self,
			
 
				+            charge_point_model,
			
 
				+            charge_point_vendor,
			
 
				+            **kwargs,
			
 
				+        ):
			
 
				+            print(f'{charge_point_model} from {charge_point_vendor} booted.')
			
 
				+
			
 
				+            now = datetime.utcnow().strftime('%Y-%m-%dT%H:%M:%S') + "Z"
			
 
				+            return call_result.BootNotificationPayload(
			
 
				+                current_time=now,
			
 
				+                interval=30,
			
 
				+                status="Accepted",
			
 
				+            )
			
 
				+    ```
			
 
				+
			
 
				+    The decorator takes an optional argument `skip_schema_validation` which
			
 
				+    defaults to False. Setting this argument to `True` will disable schema
			
 
				+    validation of the request and the response of the specific route.
			
 
				+
			
 
				+    """
			
 
				+
			
 
				+    def decorator(func):
			
 
				+        @functools.wraps(func)
			
 
				+        def inner(*args, **kwargs):
			
 
				+            return func(*args, **kwargs)
			
 
				+
			
 
				+        inner._on_action = action
			
 
				+        inner._skip_schema_validation = skip_schema_validation
			
 
				+        if func.__name__ not in routables:
			
 
				+            routables.append(func.__name__)
			
 
				+        return inner
			
 
				+
			
 
				+    return decorator
			
 
				+
			
 
				+
			
 
				+def after(action):
			
 
				+    """Function decorator to mark function as hook to post-request hook.
			
 
				+
			
 
				+    This hook's arguments are the data that is in the payload for the specific
			
 
				+    action.
			
 
				+
			
 
				+    It can be used like so:
			
 
				+
			
 
				+        @after(Action.BootNotification):
			
 
				+        def after_boot_notification():
			
 
				+            pass
			
 
				+
			
 
				+    """
			
 
				+
			
 
				+    def decorator(func):
			
 
				+        @functools.wraps(func)
			
 
				+        def inner(*args, **kwargs):
			
 
				+            return func(*args, **kwargs)
			
 
				+
			
 
				+        inner._after_action = action
			
 
				+        if func.__name__ not in routables:
			
 
				+            routables.append(func.__name__)
			
 
				+        return inner
			
 
				+
			
 
				+    return decorator
			
 
				+
			
 
				+
			
 
				+def create_route_map(obj):
			
 
				+    """
			
 
				+    Iterates of all attributes of the class looking for attributes which
			
 
				+    have been decorated by the @on() decorator It returns a dictionary where
			
 
				+    the action name are the keys and the decorated functions are the values.
			
 
				+
			
 
				+    To illustrate this with an example, consider the following function:
			
 
				+
			
 
				+        class ChargePoint:
			
 
				+
			
 
				+            @on(Action.BootNotification)
			
 
				+            def on_boot_notification(self, *args, **kwargs):
			
 
				+                pass
			
 
				+
			
 
				+            @after(Action.BootNotification)
			
 
				+            def after_boot_notification(self, *args, **kwargs):
			
 
				+                pass
			
 
				+
			
 
				+
			
 
				+    In this case this returns:
			
 
				+
			
 
				+        {
			
 
				+            Action.BootNotification: {
			
 
				+                '_on_action': <reference to 'on_boot_notification'>,
			
 
				+                '_after_action': <reference to 'after_boot_notification'>,
			
 
				+                '_skip_schema_validation': False,
			
 
				+            },
			
 
				+        }
			
 
				+
			
 
				+    """
			
 
				+    routes = {}
			
 
				+    for attr_name in routables:
			
 
				+        for option in ["_on_action", "_after_action"]:
			
 
				+            try:
			
 
				+                attr = getattr(obj, attr_name)
			
 
				+                action = getattr(attr, option)
			
 
				+
			
 
				+                if action not in routes:
			
 
				+                    routes[action] = {}
			
 
				+
			
 
				+                # Routes decorated with the `@on()` decorator can be configured
			
 
				+                # to skip validation of the input and output. For more info see
			
 
				+                # the docstring of `on()`.
			
 
				+                if option == "_on_action":
			
 
				+                    routes[action]["_skip_schema_validation"] = getattr(
			
 
				+                        attr, "_skip_schema_validation", False
			
 
				+                    )
			
 
				+
			
 
				+                routes[action][option] = attr
			
 
				+
			
 
				+            except AttributeError:
			
 
				+                continue
			
 
				+
			
 
				+    return routes
			
--- a/ocpp/ocpp/v16/__init__.py
+++ b/ocpp/ocpp/v16/__init__.py
@@ -0,0 +1,8 @@
 
				+from ocpp.charge_point import ChargePoint as cp
			
 
				+from ocpp.v16 import call, call_result
			
 
				+
			
 
				+
			
 
				+class ChargePoint(cp):
			
 
				+    _call = call
			
 
				+    _call_result = call_result
			
 
				+    _ocpp_version = "1.6"
			
--- a/ocpp/ocpp/v16/call.py
+++ b/ocpp/ocpp/v16/call.py
@@ -0,0 +1,303 @@
 
				+from dataclasses import dataclass, field
			
 
				+from typing import Dict, List, Optional
			
 
				+
			
 
				+from ocpp.v16.enums import (
			
 
				+    AvailabilityType,
			
 
				+    CertificateUse,
			
 
				+    ChargePointErrorCode,
			
 
				+    ChargePointStatus,
			
 
				+    ChargingProfilePurposeType,
			
 
				+    ChargingRateUnitType,
			
 
				+    DiagnosticsStatus,
			
 
				+    FirmwareStatus,
			
 
				+    Log,
			
 
				+    MessageTrigger,
			
 
				+    Reason,
			
 
				+    ResetType,
			
 
				+    UpdateType,
			
 
				+    UploadLogStatus,
			
 
				+)
			
 
				+
			
 
				+# Most types of CALL messages can originate from only 1 source, either
			
 
				+# from a Charge Point or Central System, but not from both.
			
 
				+#
			
 
				+# Take for example the CALL for an ChangeConfiguration action. This type of
			
 
				+# CALL can only be send from a Central System to Charging Station, not
			
 
				+# the other way around.
			
 
				+#
			
 
				+# For some types of CALL messages the opposite is true; for example for the
			
 
				+# CALL message for a BootNotification action. This can only come from a Charge
			
 
				+# Point and send to a Central System.
			
 
				+#
			
 
				+# The only CALL that can originate from both a Central System and a
			
 
				+# Charge Point is the CALL message for a DataTransfer.
			
 
				+
			
 
				+# The now following section of classes are for CALL messages that flow
			
 
				+# from Central System to Charge Point.
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class CancelReservationPayload:
			
 
				+    reservation_id: int
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class CertificateSignedPayload:
			
 
				+    certificate_chain: str
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ChangeAvailabilityPayload:
			
 
				+    connector_id: int
			
 
				+    type: AvailabilityType
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ChangeConfigurationPayload:
			
 
				+    key: str
			
 
				+    value: str
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ClearCachePayload:
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ClearChargingProfilePayload:
			
 
				+    id: Optional[int] = None
			
 
				+    connector_id: Optional[int] = None
			
 
				+    charging_profile_purpose: Optional[ChargingProfilePurposeType] = None
			
 
				+    stack_level: Optional[int] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class DeleteCertificatePayload:
			
 
				+    certificate_hash_data: Dict
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ExtendedTriggerMessagePayload:
			
 
				+    requested_message: MessageTrigger
			
 
				+    connector_id: Optional[int] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetCompositeSchedulePayload:
			
 
				+    connector_id: int
			
 
				+    duration: int
			
 
				+    charging_rate_unit: Optional[ChargingRateUnitType] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetConfigurationPayload:
			
 
				+    key: Optional[List] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetDiagnosticsPayload:
			
 
				+    location: str
			
 
				+    retries: Optional[int] = None
			
 
				+    retry_interval: Optional[int] = None
			
 
				+    start_time: Optional[str] = None
			
 
				+    stop_time: Optional[str] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetInstalledCertificateIdsPayload:
			
 
				+    certificate_type: CertificateUse
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetLocalListVersionPayload:
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetLogPayload:
			
 
				+    log: Dict
			
 
				+    log_type: Log
			
 
				+    request_id: int
			
 
				+    retries: Optional[int] = None
			
 
				+    retry_interval: Optional[int] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class InstallCertificatePayload:
			
 
				+    certificate_type: CertificateUse
			
 
				+    certificate: str
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class RemoteStartTransactionPayload:
			
 
				+    id_tag: str
			
 
				+    connector_id: Optional[int] = None
			
 
				+    charging_profile: Optional[Dict] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class RemoteStopTransactionPayload:
			
 
				+    transaction_id: int
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ReserveNowPayload:
			
 
				+    connector_id: int
			
 
				+    expiry_date: str
			
 
				+    id_tag: str
			
 
				+    reservation_id: int
			
 
				+    parent_id_tag: Optional[str] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ResetPayload:
			
 
				+    type: ResetType
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SendLocalListPayload:
			
 
				+    list_version: int
			
 
				+    update_type: UpdateType
			
 
				+    local_authorization_list: List = field(default_factory=list)
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SetChargingProfilePayload:
			
 
				+    connector_id: int
			
 
				+    cs_charging_profiles: Dict
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SignedUpdateFirmwarePayload:
			
 
				+    request_id: int
			
 
				+    firmware: Dict
			
 
				+    retries: Optional[int] = None
			
 
				+    retry_interval: Optional[int] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class TriggerMessagePayload:
			
 
				+    requested_message: MessageTrigger
			
 
				+    connector_id: Optional[int] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class UnlockConnectorPayload:
			
 
				+    connector_id: int
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class UpdateFirmwarePayload:
			
 
				+    location: str
			
 
				+    retrieve_date: str
			
 
				+    retries: Optional[int] = None
			
 
				+    retry_interval: Optional[int] = None
			
 
				+
			
 
				+
			
 
				+# The CALL messages that flow from Charge Point to Central System are listed
			
 
				+# in the bottom part of this module.
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class AuthorizePayload:
			
 
				+    id_tag: str
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class BootNotificationPayload:
			
 
				+    charge_point_model: str
			
 
				+    charge_point_vendor: str
			
 
				+    charge_box_serial_number: Optional[str] = None
			
 
				+    charge_point_serial_number: Optional[str] = None
			
 
				+    firmware_version: Optional[str] = None
			
 
				+    iccid: Optional[str] = None
			
 
				+    imsi: Optional[str] = None
			
 
				+    meter_serial_number: Optional[str] = None
			
 
				+    meter_type: Optional[str] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class DiagnosticsStatusNotificationPayload:
			
 
				+    status: DiagnosticsStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class FirmwareStatusNotificationPayload:
			
 
				+    status: FirmwareStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class HeartbeatPayload:
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class LogStatusNotificationPayload:
			
 
				+    status: UploadLogStatus
			
 
				+    request_id: int
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class MeterValuesPayload:
			
 
				+    connector_id: int
			
 
				+    meter_value: List = field(default_factory=list)
			
 
				+    transaction_id: Optional[int] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SecurityEventNotificationPayload:
			
 
				+    type: str
			
 
				+    timestamp: str
			
 
				+    tech_info: Optional[str]
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SignCertificatePayload:
			
 
				+    csr: str
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SignedFirmwareStatusNotificationPayload:
			
 
				+    status: FirmwareStatus
			
 
				+    request_id: int
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class StartTransactionPayload:
			
 
				+    connector_id: int
			
 
				+    id_tag: str
			
 
				+    meter_start: int
			
 
				+    timestamp: str
			
 
				+    reservation_id: Optional[int] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class StopTransactionPayload:
			
 
				+    meter_stop: int
			
 
				+    timestamp: str
			
 
				+    transaction_id: int
			
 
				+    reason: Optional[Reason] = None
			
 
				+    id_tag: Optional[str] = None
			
 
				+    transaction_data: Optional[List] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class StatusNotificationPayload:
			
 
				+    connector_id: int
			
 
				+    error_code: ChargePointErrorCode
			
 
				+    status: ChargePointStatus
			
 
				+    timestamp: Optional[str] = None
			
 
				+    info: Optional[str] = None
			
 
				+    vendor_id: Optional[str] = None
			
 
				+    vendor_error_code: Optional[str] = None
			
 
				+
			
 
				+
			
 
				+# The DataTransfer CALL can be send both from Central System as well as from a
			
 
				+# Charge Point.
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class DataTransferPayload:
			
 
				+    vendor_id: str
			
 
				+    message_id: Optional[str] = None
			
 
				+    data: Optional[str] = None
			
--- a/ocpp/ocpp/v16/call_result.py
+++ b/ocpp/ocpp/v16/call_result.py
@@ -0,0 +1,258 @@
 
				+from dataclasses import dataclass
			
 
				+from typing import Dict, List, Optional
			
 
				+
			
 
				+from ocpp.v16.datatypes import IdTagInfo
			
 
				+from ocpp.v16.enums import (
			
 
				+    AvailabilityStatus,
			
 
				+    CancelReservationStatus,
			
 
				+    CertificateSignedStatus,
			
 
				+    CertificateStatus,
			
 
				+    ChargingProfileStatus,
			
 
				+    ClearCacheStatus,
			
 
				+    ClearChargingProfileStatus,
			
 
				+    ConfigurationStatus,
			
 
				+    DataTransferStatus,
			
 
				+    DeleteCertificateStatus,
			
 
				+    GenericStatus,
			
 
				+    GetCompositeScheduleStatus,
			
 
				+    GetInstalledCertificateStatus,
			
 
				+    LogStatus,
			
 
				+    RegistrationStatus,
			
 
				+    RemoteStartStopStatus,
			
 
				+    ReservationStatus,
			
 
				+    ResetStatus,
			
 
				+    TriggerMessageStatus,
			
 
				+    UnlockStatus,
			
 
				+    UpdateFirmwareStatus,
			
 
				+    UpdateStatus,
			
 
				+)
			
 
				+
			
 
				+# Most types of CALLRESULT messages can originate from only 1 source, either
			
 
				+# from a Charge Point or Central System, but not from both.
			
 
				+#
			
 
				+# Take for example the CALLRESULT for an Authorize action. This type of
			
 
				+# CALLRESULT can only be send from a Central System to Charging Station, not
			
 
				+# the other way around.
			
 
				+#
			
 
				+# For some types of CALLRESULT messages the opposite is true; for example for
			
 
				+# the CALLRESULT message for a Reset action. This can only come from a Charge
			
 
				+# Point to a Central System.
			
 
				+#
			
 
				+# The only CALLRESULT that can originate from both a Central System and a
			
 
				+# Charge Point is the CALLRESULT message for a DataTransfer.
			
 
				+
			
 
				+# The now following section of classes are for CALLRESULT messages that flow
			
 
				+# from Central System to Charge Point.
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class AuthorizePayload:
			
 
				+    id_tag_info: IdTagInfo
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class BootNotificationPayload:
			
 
				+    current_time: str
			
 
				+    interval: int
			
 
				+    status: RegistrationStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class DiagnosticsStatusNotificationPayload:
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class FirmwareStatusNotificationPayload:
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class HeartbeatPayload:
			
 
				+    current_time: str
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class LogStatusNotificationPayload:
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SecurityEventNotificationPayload:
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SignCertificatePayload:
			
 
				+    status: GenericStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class MeterValuesPayload:
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class StartTransactionPayload:
			
 
				+    transaction_id: int
			
 
				+    id_tag_info: IdTagInfo
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class StatusNotificationPayload:
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class StopTransactionPayload:
			
 
				+    id_tag_info: Optional[IdTagInfo] = None
			
 
				+
			
 
				+
			
 
				+# The CALLRESULT messages that flow from Charge Point to Central System are
			
 
				+# listed in the bottom part of this module.
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class CancelReservationPayload:
			
 
				+    status: CancelReservationStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class CertificateSignedPayload:
			
 
				+    status: CertificateSignedStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ChangeAvailabilityPayload:
			
 
				+    status: AvailabilityStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ChangeConfigurationPayload:
			
 
				+    status: ConfigurationStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ClearCachePayload:
			
 
				+    status: ClearCacheStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ClearChargingProfilePayload:
			
 
				+    status: ClearChargingProfileStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class DeleteCertificatePayload:
			
 
				+    status: DeleteCertificateStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ExtendedTriggerMessagePayload:
			
 
				+    status: TriggerMessageStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetInstalledCertificateIdsPayload:
			
 
				+    status: GetInstalledCertificateStatus
			
 
				+    certificate_hash_data: Optional[List] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetCompositeSchedulePayload:
			
 
				+    status: GetCompositeScheduleStatus
			
 
				+    connector_id: Optional[int] = None
			
 
				+    schedule_start: Optional[str] = None
			
 
				+    charging_schedule: Optional[Dict] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetConfigurationPayload:
			
 
				+    configuration_key: Optional[List] = None
			
 
				+    unknown_key: Optional[List] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetDiagnosticsPayload:
			
 
				+    file_name: Optional[str] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetLocalListVersionPayload:
			
 
				+    list_version: int
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class GetLogPayload:
			
 
				+    status: LogStatus
			
 
				+    filename: Optional[str] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class InstallCertificatePayload:
			
 
				+    status: CertificateStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class RemoteStartTransactionPayload:
			
 
				+    status: RemoteStartStopStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class RemoteStopTransactionPayload:
			
 
				+    status: RemoteStartStopStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ReserveNowPayload:
			
 
				+    status: ReservationStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ResetPayload:
			
 
				+    status: ResetStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SendLocalListPayload:
			
 
				+    status: UpdateStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SetChargingProfilePayload:
			
 
				+    status: ChargingProfileStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SignedFirmwareStatusNotificationPayload:
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SignedUpdateFirmwarePayload:
			
 
				+    status: UpdateFirmwareStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class TriggerMessagePayload:
			
 
				+    status: TriggerMessageStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class UnlockConnectorPayload:
			
 
				+    status: UnlockStatus
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class UpdateFirmwarePayload:
			
 
				+    pass
			
 
				+
			
 
				+
			
 
				+# The DataTransfer CALLRESULT can be send both from Central System as well as
			
 
				+# from a Charge Point.
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class DataTransferPayload:
			
 
				+    status: DataTransferStatus
			
 
				+    data: Optional[str] = None
			
--- a/ocpp/ocpp/v16/datatypes.py
+++ b/ocpp/ocpp/v16/datatypes.py
@@ -0,0 +1,166 @@
 
				+from dataclasses import dataclass
			
 
				+from typing import List, Optional
			
 
				+
			
 
				+from ocpp.v16.enums import (
			
 
				+    AuthorizationStatus,
			
 
				+    ChargingProfileKindType,
			
 
				+    ChargingProfilePurposeType,
			
 
				+    ChargingRateUnitType,
			
 
				+    CiStringType,
			
 
				+    HashAlgorithm,
			
 
				+    Location,
			
 
				+    Measurand,
			
 
				+    Phase,
			
 
				+    ReadingContext,
			
 
				+    RecurrencyKind,
			
 
				+    UnitOfMeasure,
			
 
				+    ValueFormat,
			
 
				+)
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class IdTagInfo:
			
 
				+    """
			
 
				+    Contains status information about an identifier. It is returned in
			
 
				+    Authorize, Start Transaction and Stop Transaction responses.
			
 
				+
			
 
				+    If expiryDate is not given, the status has no end date.
			
 
				+    """
			
 
				+
			
 
				+    status: AuthorizationStatus
			
 
				+    parent_id_tag: Optional[str] = None
			
 
				+    expiry_date: Optional[str] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class AuthorizationData:
			
 
				+    """
			
 
				+    Elements that constitute an entry of a Local Authorization List update.
			
 
				+    """
			
 
				+
			
 
				+    id_tag: str
			
 
				+    id_tag_info: Optional[IdTagInfo] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ChargingSchedulePeriod:
			
 
				+    start_period: int
			
 
				+    limit: float
			
 
				+    number_phases: Optional[int] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ChargingSchedule:
			
 
				+    charging_rate_unit: ChargingRateUnitType
			
 
				+    charging_schedule_period: List[ChargingSchedulePeriod]
			
 
				+    duration: Optional[int] = None
			
 
				+    start_schedule: Optional[str] = None
			
 
				+    min_charging_rate: Optional[float] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class ChargingProfile:
			
 
				+    """
			
 
				+    A ChargingProfile consists of a ChargingSchedule, describing the
			
 
				+    amount of power or current that can be delivered per time interval.
			
 
				+    """
			
 
				+
			
 
				+    charging_profile_id: int
			
 
				+    stack_level: int
			
 
				+    charging_profile_purpose: ChargingProfilePurposeType
			
 
				+    charging_profile_kind: ChargingProfileKindType
			
 
				+    charging_schedule: ChargingSchedule
			
 
				+    transaction_id: Optional[int] = None
			
 
				+    recurrency_kind: Optional[RecurrencyKind] = None
			
 
				+    valid_from: Optional[str] = None
			
 
				+    valid_to: Optional[str] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class KeyValue:
			
 
				+    """
			
 
				+    Contains information about a specific configuration key.
			
 
				+    It is returned in GetConfiguration.conf.
			
 
				+    """
			
 
				+
			
 
				+    key: str
			
 
				+    readonly: bool
			
 
				+    value: Optional[str] = None
			
 
				+
			
 
				+    def __post_init__(self):
			
 
				+        if len(self.key) > CiStringType.ci_string_50:
			
 
				+            msg = "Field key is longer than 50 characters"
			
 
				+            raise ValueError(msg)
			
 
				+
			
 
				+        if self.value and len(self.value) > CiStringType.ci_string_500:
			
 
				+            msg = "Field key is longer than 500 characters"
			
 
				+            raise ValueError(msg)
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class SampledValue:
			
 
				+    """
			
 
				+    Single sampled value in MeterValues. Each value can be accompanied by
			
 
				+    optional fields.
			
 
				+    """
			
 
				+
			
 
				+    value: str
			
 
				+    context: ReadingContext
			
 
				+    format: Optional[ValueFormat] = None
			
 
				+    measurand: Optional[Measurand] = None
			
 
				+    phase: Optional[Phase] = None
			
 
				+    location: Optional[Location] = None
			
 
				+    unit: Optional[UnitOfMeasure] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class MeterValue:
			
 
				+    """
			
 
				+    Collection of one or more sampled values in MeterValues.req.
			
 
				+    All sampled values in a MeterValue are sampled at the same point in time.
			
 
				+    """
			
 
				+
			
 
				+    timestamp: str
			
 
				+    sampled_value: List[SampledValue]
			
 
				+
			
 
				+
			
 
				+# Security Extension
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class CertificateHashData:
			
 
				+    """
			
 
				+    CertificateHashDataType is used by:
			
 
				+    DeleteCertificate.req, GetInstalledCertificateIds.conf
			
 
				+    """
			
 
				+
			
 
				+    hash_algorithm: HashAlgorithm
			
 
				+    issuer_name_hash: str
			
 
				+    issuer_key_hash: str
			
 
				+    serial_number: str
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class Firmware:
			
 
				+    """
			
 
				+    Represents a copy of the firmware that can be loaded/updated on the Charge Point.
			
 
				+    FirmwareType is used by: SignedUpdateFirmware.req
			
 
				+    """
			
 
				+
			
 
				+    location: str
			
 
				+    retrieve_date_time: str
			
 
				+    signing_certificate: str
			
 
				+    install_date_time: Optional[str] = None
			
 
				+    signature: Optional[str] = None
			
 
				+
			
 
				+
			
 
				+@dataclass
			
 
				+class LogParameters:
			
 
				+    """
			
 
				+    Class for detailed information the retrieval of logging entries.
			
 
				+    LogParametersType is used by: GetLog.req
			
 
				+    """
			
 
				+
			
 
				+    remote_location: str
			
 
				+    oldest_timestamp: Optional[str] = None
			
 
				+    latest_timestamp: Optional[str] = None
			
--- a/ocpp/ocpp/v16/enums.py
+++ b/ocpp/ocpp/v16/enums.py
@@ -0,0 +1,852 @@
 
				+from enum import Enum
			
 
				+
			
 
				+
			
 
				+class Action(str, Enum):
			
 
				+    """An Action is a required part of a Call message."""
			
 
				+
			
 
				+    Authorize = "Authorize"
			
 
				+    BootNotification = "BootNotification"
			
 
				+    CancelReservation = "CancelReservation"
			
 
				+    CertificateSigned = "CertificateSigned"
			
 
				+    ChangeAvailability = "ChangeAvailability"
			
 
				+    ChangeConfiguration = "ChangeConfiguration"
			
 
				+    ClearCache = "ClearCache"
			
 
				+    ClearChargingProfile = "ClearChargingProfile"
			
 
				+    DataTransfer = "DataTransfer"
			
 
				+    DeleteCertificate = "DeleteCertificate"
			
 
				+    DiagnosticsStatusNotification = "DiagnosticsStatusNotification"
			
 
				+    ExtendedTriggerMessage = "ExtendedTriggerMessage"
			
 
				+    FirmwareStatusNotification = "FirmwareStatusNotification"
			
 
				+    GetCompositeSchedule = "GetCompositeSchedule"
			
 
				+    GetConfiguration = "GetConfiguration"
			
 
				+    GetDiagnostics = "GetDiagnostics"
			
 
				+    GetInstalledCertificateIds = "GetInstalledCertificateIds"
			
 
				+    GetLocalListVersion = "GetLocalListVersion"
			
 
				+    GetLog = "GetLog"
			
 
				+    Heartbeat = "Heartbeat"
			
 
				+    InstallCertificate = "InstallCertificate"
			
 
				+    LogStatusNotification = "LogStatusNotification"
			
 
				+    MeterValues = "MeterValues"
			
 
				+    RemoteStartTransaction = "RemoteStartTransaction"
			
 
				+    RemoteStopTransaction = "RemoteStopTransaction"
			
 
				+    ReserveNow = "ReserveNow"
			
 
				+    Reset = "Reset"
			
 
				+    SecurityEventNotification = "SecurityEventNotification"
			
 
				+    SendLocalList = "SendLocalList"
			
 
				+    SetChargingProfile = "SetChargingProfile"
			
 
				+    SignCertificate = "SignCertificate"
			
 
				+    SignedFirmwareStatusNotification = "SignedFirmwareStatusNotification"
			
 
				+    SignedUpdateFirmware = "SignedUpdateFirmware"
			
 
				+    StartTransaction = "StartTransaction"
			
 
				+    StatusNotification = "StatusNotification"
			
 
				+    StopTransaction = "StopTransaction"
			
 
				+    TriggerMessage = "TriggerMessage"
			
 
				+    UnlockConnector = "UnlockConnector"
			
 
				+    UpdateFirmware = "UpdateFirmware"
			
 
				+
			
 
				+
			
 
				+class AuthorizationStatus(str, Enum):
			
 
				+    """
			
 
				+    Elements that constitute an entry of a Local Authorization List update.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    blocked = "Blocked"
			
 
				+    expired = "Expired"
			
 
				+    invalid = "Invalid"
			
 
				+    concurrent_tx = "ConcurrentTx"
			
 
				+
			
 
				+
			
 
				+class AvailabilityStatus(str, Enum):
			
 
				+    """
			
 
				+    Status returned in response to ChangeAvailability.req.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+    scheduled = "Scheduled"
			
 
				+
			
 
				+
			
 
				+class AvailabilityType(str, Enum):
			
 
				+    """
			
 
				+    Requested availability change in ChangeAvailability.req.
			
 
				+    """
			
 
				+
			
 
				+    inoperative = "Inoperative"
			
 
				+    operative = "Operative"
			
 
				+
			
 
				+
			
 
				+class CancelReservationStatus(str, Enum):
			
 
				+    """
			
 
				+    Status in CancelReservation.conf.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+
			
 
				+
			
 
				+class CertificateSignedStatus(str, Enum):
			
 
				+    """
			
 
				+    CertificateSignedStatusEnumType is used by: CertificateSigned.conf
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+
			
 
				+
			
 
				+class CertificateStatus(str, Enum):
			
 
				+    """
			
 
				+    CertificateStatusEnumType is used by: InstallCertificate.conf
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+    failed = "Failed"
			
 
				+
			
 
				+
			
 
				+class CertificateUse(str, Enum):
			
 
				+    """
			
 
				+    CertificateUseEnumType is used by: GetInstalledCertificateIds.req,
			
 
				+    InstallCertificate.req
			
 
				+    """
			
 
				+
			
 
				+    central_system_root_certificate = "CentralSystemRootCertificate"
			
 
				+    manufacturer_root_certificate = "ManufacturerRootCertificate"
			
 
				+
			
 
				+
			
 
				+class ChargePointErrorCode(str, Enum):
			
 
				+    """
			
 
				+    Charge Point status reported in StatusNotification.req.
			
 
				+    """
			
 
				+
			
 
				+    connector_lock_failure = "ConnectorLockFailure"
			
 
				+    ev_communication_error = "EVCommunicationError"
			
 
				+    ground_failure = "GroundFailure"
			
 
				+    high_temperature = "HighTemperature"
			
 
				+    internal_error = "InternalError"
			
 
				+    local_list_conflict = "LocalListConflict"
			
 
				+    no_error = "NoError"
			
 
				+    other_error = "OtherError"
			
 
				+    over_current_failure = "OverCurrentFailure"
			
 
				+    over_voltage = "OverVoltage"
			
 
				+    power_meter_failure = "PowerMeterFailure"
			
 
				+    power_switch_failure = "PowerSwitchFailure"
			
 
				+    reader_failure = "ReaderFailure"
			
 
				+    reset_failure = "ResetFailure"
			
 
				+    under_voltage = "UnderVoltage"
			
 
				+    weak_signal = "WeakSignal"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    connectorLockFailure = "ConnectorLockFailure"
			
 
				+    evCommunicationError = "EVCommunicationError"
			
 
				+    groundFailure = "GroundFailure"
			
 
				+    highTemperature = "HighTemperature"
			
 
				+    internalError = "InternalError"
			
 
				+    localListConflict = "LocalListConflict"
			
 
				+    noError = "NoError"
			
 
				+    otherError = "OtherError"
			
 
				+    overCurrentFailure = "OverCurrentFailure"
			
 
				+    overVoltage = "OverVoltage"
			
 
				+    powerMeterFailure = "PowerMeterFailure"
			
 
				+    powerSwitchFailure = "PowerSwitchFailure"
			
 
				+    readerFailure = "ReaderFailure"
			
 
				+    resetFailure = "ResetFailure"
			
 
				+    underVoltage = "UnderVoltage"
			
 
				+    weakSignal = "WeakSignal"
			
 
				+
			
 
				+
			
 
				+class ChargePointStatus(str, Enum):
			
 
				+    """
			
 
				+    Status reported in StatusNotification.req. A status can be reported for
			
 
				+    the Charge Point main controller (connectorId = 0) or for a specific
			
 
				+    connector. Status for the Charge Point main controller is a subset of the
			
 
				+    enumeration: Available, Unavailable or Faulted.
			
 
				+
			
 
				+    States considered Operative are: Available, Preparing, Charging,
			
 
				+    SuspendedEVSE, SuspendedEV, Finishing, Reserved.
			
 
				+    States considered Inoperative are: Unavailable, Faulted.
			
 
				+    """
			
 
				+
			
 
				+    available = "Available"
			
 
				+    preparing = "Preparing"
			
 
				+    charging = "Charging"
			
 
				+    suspended_evse = "SuspendedEVSE"
			
 
				+    suspended_ev = "SuspendedEV"
			
 
				+    finishing = "Finishing"
			
 
				+    reserved = "Reserved"
			
 
				+    unavailable = "Unavailable"
			
 
				+    faulted = "Faulted"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    suspendedevse = "SuspendedEVSE"
			
 
				+    suspendedev = "SuspendedEV"
			
 
				+
			
 
				+
			
 
				+class ChargingProfileKindType(str, Enum):
			
 
				+    """
			
 
				+    "Absolute": Schedule periods are relative to a fixed point in time defined
			
 
				+                in the schedule.
			
 
				+    "Recurring": Schedule restarts periodically at the first schedule period.
			
 
				+    "Relative": Schedule periods are relative to a situation- specific start
			
 
				+                point(such as the start of a session)
			
 
				+    """
			
 
				+
			
 
				+    absolute = "Absolute"
			
 
				+    recurring = "Recurring"
			
 
				+    relative = "Relative"
			
 
				+
			
 
				+
			
 
				+class ChargingProfilePurposeType(str, Enum):
			
 
				+    """
			
 
				+    In load balancing scenarios, the Charge Point has one or more local
			
 
				+    charging profiles that limit the power or current to be shared by all
			
 
				+    connectors of the Charge Point. The Central System SHALL configure such
			
 
				+    a profile with ChargingProfilePurpose set to “ChargePointMaxProfile”.
			
 
				+    ChargePointMaxProfile can only be set at Charge Point ConnectorId 0.
			
 
				+
			
 
				+    Default schedules for new transactions MAY be used to impose charging
			
 
				+    policies. An example could be a policy that prevents charging during
			
 
				+    the day. For schedules of this purpose, ChargingProfilePurpose SHALL
			
 
				+    be set to TxDefaultProfile. If TxDefaultProfile is set to ConnectorId 0,
			
 
				+    the TxDefaultProfile is applicable to all Connectors. If ConnectorId is
			
 
				+    set >0, it only applies to that specific connector. In the event a
			
 
				+    TxDefaultProfile for connector 0 is installed, and the Central
			
 
				+    System sends a new profile with ConnectorId >0, the TxDefaultProfile
			
 
				+    SHALL be replaced only for that specific connector.
			
 
				+
			
 
				+    If a transaction-specific profile with purpose TxProfile is present,
			
 
				+    it SHALL overrule the default charging profile with purpose
			
 
				+    TxDefaultProfile for the duration of the current transaction only.
			
 
				+    After the transaction is stopped, the profile SHOULD be deleted.
			
 
				+    If there is no transaction active on the connector specified in a
			
 
				+    charging profile of type TxProfile, then the Charge Point SHALL
			
 
				+    discard it and return an error status in SetChargingProfile.conf.
			
 
				+    TxProfile SHALL only be set at Charge Point ConnectorId >0.
			
 
				+
			
 
				+    It is not possible to set a ChargingProfile with purpose set to
			
 
				+    TxProfile without presence of an active transaction, or in advance of
			
 
				+    a transaction.
			
 
				+
			
 
				+    In order to ensure that the updated charging profile applies only to the
			
 
				+    current transaction, the chargingProfilePurpose of the ChargingProfile
			
 
				+    MUST be set to TxProfile.
			
 
				+    """
			
 
				+
			
 
				+    charge_point_max_profile = "ChargePointMaxProfile"
			
 
				+    tx_default_profile = "TxDefaultProfile"
			
 
				+    tx_profile = "TxProfile"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    chargepointmaxprofile = "ChargePointMaxProfile"
			
 
				+    txdefaultprofile = "TxDefaultProfile"
			
 
				+    txprofile = "TxProfile"
			
 
				+
			
 
				+
			
 
				+class ChargingProfileStatus(str, Enum):
			
 
				+    """
			
 
				+    Status returned in response to SetChargingProfile.req.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+    not_supported = "NotSupported"
			
 
				+    # Soon to be deprecated enums
			
 
				+    notSupported = "NotSupported"
			
 
				+
			
 
				+
			
 
				+class ChargingRateUnitType(str, Enum):
			
 
				+    """
			
 
				+    Unit in which a charging schedule is defined, as used in:
			
 
				+    GetCompositeSchedule.req and ChargingSchedule
			
 
				+    """
			
 
				+
			
 
				+    watts = "W"
			
 
				+    amps = "A"
			
 
				+
			
 
				+
			
 
				+class CiStringType(int):
			
 
				+    """
			
 
				+    Generic used case insensitive string of X characters
			
 
				+    """
			
 
				+
			
 
				+    ci_string_20 = 20
			
 
				+    ci_string_25 = 25
			
 
				+    ci_string_50 = 50
			
 
				+    ci_string_255 = 255
			
 
				+    ci_string_500 = 500
			
 
				+
			
 
				+
			
 
				+class ClearCacheStatus(str, Enum):
			
 
				+    """
			
 
				+    Status returned in response to ClearCache.req.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+
			
 
				+
			
 
				+class ClearChargingProfileStatus(str, Enum):
			
 
				+    """
			
 
				+    Status returned in response to ClearChargingProfile.req.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    unknown = "Unknown"
			
 
				+
			
 
				+
			
 
				+class ConfigurationStatus(str, Enum):
			
 
				+    """
			
 
				+    Status in ChangeConfiguration.conf.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+    reboot_required = "RebootRequired"
			
 
				+    not_supported = "NotSupported"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    rebootRequired = "RebootRequired"
			
 
				+    notSupported = "NotSupported"
			
 
				+
			
 
				+
			
 
				+class ConfigurationKey(str, Enum):
			
 
				+    """
			
 
				+    Configuration Key Names.
			
 
				+    """
			
 
				+
			
 
				+    # 9.1 Core Profile
			
 
				+    allow_offline_tx_for_unknown_id = "AllowOfflineTxForUnknownId"
			
 
				+    authorization_cache_enabled = "AuthorizationCacheEnabled"
			
 
				+    authorize_remote_tx_requests = "AuthorizeRemoteTxRequests"
			
 
				+    blink_repeat = "BlinkRepeat"
			
 
				+    clock_aligned_data_interval = "ClockAlignedDataInterval"
			
 
				+    connection_time_out = "ConnectionTimeOut"
			
 
				+    connector_phase_rotation = "ConnectorPhaseRotation"
			
 
				+    connector_phase_rotation_max_length = "ConnectorPhaseRotationMaxLength"
			
 
				+    get_configuration_max_keys = "GetConfigurationMaxKeys"
			
 
				+    heartbeat_interval = "HeartbeatInterval"
			
 
				+    light_intensity = "LightIntensity"
			
 
				+    local_authorize_offline = "LocalAuthorizeOffline"
			
 
				+    local_pre_authorize = "LocalPreAuthorize"
			
 
				+    max_energy_on_invalid_id = "MaxEnergyOnInvalidId"
			
 
				+    meter_values_aligned_data = "MeterValuesAlignedData"
			
 
				+    meter_values_aligned_data_max_length = "MeterValuesAlignedDataMaxLength"
			
 
				+    meter_values_sampled_data = "MeterValuesSampledData"
			
 
				+    meter_values_sampled_data_max_length = "MeterValuesSampledDataMaxLength"
			
 
				+    meter_value_sample_interval = "MeterValueSampleInterval"
			
 
				+    minimum_status_duration = "MinimumStatusDuration"
			
 
				+    number_of_connectors = "NumberOfConnectors"
			
 
				+    reset_retries = "ResetRetries"
			
 
				+    stop_transaction_on_ev_side_disconnect = "StopTransactionOnEVSideDisconnect"
			
 
				+    stop_transaction_on_invalid_id = "StopTransactionOnInvalidId"
			
 
				+    stop_txn_aligned_data = "StopTxnAlignedData"
			
 
				+    stop_txn_aligned_data_max_length = "StopTxnAlignedDataMaxLength"
			
 
				+    stop_txn_sampled_data = "StopTxnSampledData"
			
 
				+    stop_txn_sampled_data_max_length = "StopTxnSampledDataMaxLength"
			
 
				+    supported_feature_profiles = "SupportedFeatureProfiles"
			
 
				+    supported_feature_profiles_max_length = "SupportedFeatureProfilesMaxLength"
			
 
				+    transaction_message_attempts = "TransactionMessageAttempts"
			
 
				+    transaction_message_retry_interval = "TransactionMessageRetryInterval"
			
 
				+    unlock_connector_on_ev_side_disconnect = "UnlockConnectorOnEVSideDisconnect"
			
 
				+    web_socket_ping_interval = "WebSocketPingInterval"
			
 
				+
			
 
				+    # 9.2 Local Auth List Management Profile
			
 
				+    local_auth_list_enabled = "LocalAuthListEnabled"
			
 
				+    local_auth_list_max_length = "LocalAuthListMaxLength"
			
 
				+    send_local_list_max_length = "SendLocalListMaxLength"
			
 
				+
			
 
				+    # 9.3 Reservation Profile
			
 
				+    reserve_connector_zero_supported = "ReserveConnectorZeroSupported"
			
 
				+
			
 
				+    # 9.4 Smart Charging Profile
			
 
				+    charge_profile_max_stack_level = "ChargeProfileMaxStackLevel"
			
 
				+    charging_schedule_allowed_charging_rate_unit = (
			
 
				+        "ChargingScheduleAllowedChargingRateUnit"
			
 
				+    )
			
 
				+    charging_schedule_max_periods = "ChargingScheduleMaxPeriods"
			
 
				+    connector_switch_3to1_phase_supported = "ConnectorSwitch3to1PhaseSupported"
			
 
				+    max_charging_profiles_installed = "MaxChargingProfilesInstalled"
			
 
				+
			
 
				+    # OCPP 1.6 ISO 15118 v10 added configuration keys
			
 
				+    central_contract_validation_allowed = "CentralContractValidationAllowed"
			
 
				+    certificate_signed_max_chain_size = "CertificateSignedMaxChainSize"
			
 
				+    cert_signing_wait_minimum = "CertSigningWaitMinimum"
			
 
				+    cert_signing_repeat_times = "CertSigningRepeatTimes"
			
 
				+    certificate_store_max_length = "CertificateStoreMaxLength"
			
 
				+    contract_validation_offline = "ContractValidationOffline"
			
 
				+    iso_15118_pnc_enabled = "ISO15118PnCEnabled"
			
 
				+
			
 
				+    # OCPP security whitepaper added configuration keys
			
 
				+    additional_root_certificate_check = "AdditionalRootCertificateCheck"
			
 
				+    authorization_key = "AuthorizationKey"
			
 
				+    cpo_name = "CpoName"
			
 
				+    security_profile = "SecurityProfile"
			
 
				+
			
 
				+
			
 
				+class DataTransferStatus(str, Enum):
			
 
				+    """
			
 
				+    Status in DataTransfer.conf.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+    unknown_message_id = "UnknownMessageId"
			
 
				+    unknown_vendor_id = "UnknownVendorId"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    unknownMessageId = "UnknownMessageId"
			
 
				+    unknownVendorId = "UnknownVendorId"
			
 
				+
			
 
				+
			
 
				+class DeleteCertificateStatus(str, Enum):
			
 
				+    """
			
 
				+    DeleteCertificateStatusEnumType is used by: DeleteCertificate.conf
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    failed = "Failed"
			
 
				+    not_found = "NotFound"
			
 
				+
			
 
				+
			
 
				+class DiagnosticsStatus(str, Enum):
			
 
				+    """
			
 
				+    Status in DiagnosticsStatusNotification.req.
			
 
				+    """
			
 
				+
			
 
				+    idle = "Idle"
			
 
				+    uploaded = "Uploaded"
			
 
				+    upload_failed = "UploadFailed"
			
 
				+    uploading = "Uploading"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    uploadFailed = "UploadFailed"
			
 
				+
			
 
				+
			
 
				+class FirmwareStatus(str, Enum):
			
 
				+    """
			
 
				+    Status of a firmware download as reported in FirmwareStatusNotification.req
			
 
				+    """
			
 
				+
			
 
				+    # Common for:
			
 
				+    # FirmwareStatusNotification.req and SignedFirmwareStatusNotification.req
			
 
				+    downloaded = "Downloaded"
			
 
				+    download_failed = "DownloadFailed"
			
 
				+    downloading = "Downloading"
			
 
				+    idle = "Idle"
			
 
				+    installation_failed = "InstallationFailed"
			
 
				+    installing = "Installing"
			
 
				+    installed = "Installed"
			
 
				+
			
 
				+    # Only for SignedFirmwareStatusNotification.reg
			
 
				+    download_scheduled = "DownloadScheduled"
			
 
				+    download_paused = "DownloadPaused"
			
 
				+    install_rebooting = "InstallRebooting"
			
 
				+    install_scheduled = "InstallScheduled"
			
 
				+    install_verification_failed = "InstallVerificationFailed"
			
 
				+    invalid_signature = "InvalidSignature"
			
 
				+    signature_verified = "SignatureVerified"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    downloadFailed = "DownloadFailed"
			
 
				+    installationFailed = "InstallationFailed"
			
 
				+
			
 
				+
			
 
				+class GenericStatus(str, Enum):
			
 
				+    """
			
 
				+    Generic message response status
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+
			
 
				+
			
 
				+class GetCompositeScheduleStatus(str, Enum):
			
 
				+    """
			
 
				+    Status returned in response to GetCompositeSchedule.req
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+
			
 
				+
			
 
				+class GetInstalledCertificateStatus(str, Enum):
			
 
				+    """
			
 
				+    GetInstalledCertificateStatusEnumType is used by:
			
 
				+    GetInstalledCertificateIds.conf
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    not_found = "NotFound"
			
 
				+
			
 
				+
			
 
				+class HashAlgorithm(str, Enum):
			
 
				+    """
			
 
				+    HashAlgorithmEnumType is used by: CertificateHashDataType
			
 
				+    """
			
 
				+
			
 
				+    sha256 = "SHA256"
			
 
				+    sha384 = "SHA384"
			
 
				+    sha512 = "SHA512"
			
 
				+
			
 
				+
			
 
				+class Location(str, Enum):
			
 
				+    """
			
 
				+    Allowable values of the optional "location" field of a value element in
			
 
				+    SampledValue.
			
 
				+    """
			
 
				+
			
 
				+    inlet = "Inlet"
			
 
				+    outlet = "Outlet"
			
 
				+    body = "Body"
			
 
				+    cable = "Cable"
			
 
				+    ev = "EV"
			
 
				+
			
 
				+
			
 
				+class Log(str, Enum):
			
 
				+    """
			
 
				+    LogEnumType is used by GetLog.req
			
 
				+    """
			
 
				+
			
 
				+    diagnostics_log = "DiagnosticsLog"
			
 
				+    security_log = "SecurityLog"
			
 
				+
			
 
				+
			
 
				+class LogStatus(str, Enum):
			
 
				+    """
			
 
				+    LogStatusEnumType is used by: GetLog.conf
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+    accepted_canceled = "AcceptedCanceled"
			
 
				+
			
 
				+
			
 
				+class Measurand(str, Enum):
			
 
				+    """
			
 
				+    Allowable values of the optional "measurand" field of a Value element, as
			
 
				+    used in MeterValues.req and StopTransaction.req messages. Default value of
			
 
				+    "measurand" is always "Energy.Active.Import.Register"
			
 
				+    """
			
 
				+
			
 
				+    current_export = "Current.Export"
			
 
				+    current_import = "Current.Import"
			
 
				+    current_offered = "Current.Offered"
			
 
				+    energy_active_export_register = "Energy.Active.Export.Register"
			
 
				+    energy_active_import_register = "Energy.Active.Import.Register"
			
 
				+    energy_reactive_export_register = "Energy.Reactive.Export.Register"
			
 
				+    energy_reactive_import_register = "Energy.Reactive.Import.Register"
			
 
				+    energy_active_export_interval = "Energy.Active.Export.Interval"
			
 
				+    energy_active_import_interval = "Energy.Active.Import.Interval"
			
 
				+    energy_reactive_export_interval = "Energy.Reactive.Export.Interval"
			
 
				+    energy_reactive_import_interval = "Energy.Reactive.Import.Interval"
			
 
				+    frequency = "Frequency"
			
 
				+    power_active_export = "Power.Active.Export"
			
 
				+    power_active_import = "Power.Active.Import"
			
 
				+    power_factor = "Power.Factor"
			
 
				+    power_offered = "Power.Offered"
			
 
				+    power_reactive_export = "Power.Reactive.Export"
			
 
				+    power_reactive_import = "Power.Reactive.Import"
			
 
				+    rpm = "RPM"
			
 
				+    soc = "SoC"
			
 
				+    temperature = "Temperature"
			
 
				+    voltage = "Voltage"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    currentExport = "Current.Export"
			
 
				+    currentImport = "Current.Import"
			
 
				+    currentOffered = "Current.Offered"
			
 
				+    energyActiveExportRegister = "Energy.Active.Export.Register"
			
 
				+    energyActiveImportRegister = "Energy.Active.Import.Register"
			
 
				+    energyReactiveExportRegister = "Energy.Reactive.Export.Register"
			
 
				+    energyReactiveImportRegister = "Energy.Reactive.Import.Register"
			
 
				+    energyActiveExportInterval = "Energy.Active.Export.Interval"
			
 
				+    energyActiveImportInterval = "Energy.Active.Import.Interval"
			
 
				+    energyReactiveExportInterval = "Energy.Reactive.Export.Interval"
			
 
				+    energyReactiveImportInterval = "Energy.Reactive.Import.Interval"
			
 
				+    powerActiveExport = "Power.Active.Export"
			
 
				+    powerActiveImport = "Power.Active.Import"
			
 
				+    powerFactor = "Power.Factor"
			
 
				+    powerOffered = "Power.Offered"
			
 
				+    powerReactiveExport = "Power.Reactive.Export"
			
 
				+    powerReactiveImport = "Power.Reactive.Import"
			
 
				+
			
 
				+
			
 
				+class MessageTrigger(str, Enum):
			
 
				+    """
			
 
				+    Type of request to be triggered in a TriggerMessage.req
			
 
				+    """
			
 
				+
			
 
				+    # Common for TriggerMessage.req and ExtendedTriggerMessage.req
			
 
				+    boot_notification = "BootNotification"
			
 
				+    firmware_status_notification = "FirmwareStatusNotification"
			
 
				+    heartbeat = "Heartbeat"
			
 
				+    meter_values = "MeterValues"
			
 
				+    status_notification = "StatusNotification"
			
 
				+
			
 
				+    # Only for TriggerMessage.req
			
 
				+    diagnostics_status_notification = "DiagnosticsStatusNotification"
			
 
				+
			
 
				+    # Only for ExtendedTriggerMessage.req
			
 
				+    log_status_notification = "LogStatusNotification"
			
 
				+    sign_charge_point_certificate = "SignChargePointCertificate"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    bootNotification = "BootNotification"
			
 
				+    diagnosticsStatusNotification = "DiagnosticsStatusNotification"
			
 
				+    firmwareStatusNotification = "FirmwareStatusNotification"
			
 
				+    meterValues = "MeterValues"
			
 
				+    statusNotification = "StatusNotification"
			
 
				+
			
 
				+
			
 
				+class Phase(str, Enum):
			
 
				+    """
			
 
				+    Phase as used in SampledValue. Phase specifies how a measured value is to
			
 
				+    be interpreted. Please note that not all values of Phase are applicable to
			
 
				+    all Measurands.
			
 
				+    """
			
 
				+
			
 
				+    l1 = "L1"
			
 
				+    l2 = "L2"
			
 
				+    l3 = "L3"
			
 
				+    n = "N"
			
 
				+    l1_n = "L1-N"
			
 
				+    l2_n = "L2-N"
			
 
				+    l3_n = "L3-N"
			
 
				+    l1_l2 = "L1-L2"
			
 
				+    l2_l3 = "L2-L3"
			
 
				+    l3_l1 = "L3-L1"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    l1n = "L1-N"
			
 
				+    l2n = "L2-N"
			
 
				+    l3n = "L3-N"
			
 
				+    l1l2 = "L1-L2"
			
 
				+    l2l3 = "L2-L3"
			
 
				+    l3l1 = "L3-L1"
			
 
				+
			
 
				+
			
 
				+class ReadingContext(str, Enum):
			
 
				+    """
			
 
				+    Values of the context field of a value in SampledValue.
			
 
				+    """
			
 
				+
			
 
				+    interruption_begin = "Interruption.Begin"
			
 
				+    interruption_end = "Interruption.End"
			
 
				+    other = "Other"
			
 
				+    sample_clock = "Sample.Clock"
			
 
				+    sample_periodic = "Sample.Periodic"
			
 
				+    transaction_begin = "Transaction.Begin"
			
 
				+    transaction_end = "Transaction.End"
			
 
				+    trigger = "Trigger"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    interruptionBegin = "Interruption.Begin"
			
 
				+    interruptionEnd = "Interruption.End"
			
 
				+    sampleClock = "Sample.Clock"
			
 
				+    samplePeriodic = "Sample.Periodic"
			
 
				+    transactionBegin = "Transaction.Begin"
			
 
				+    transactionEnd = "Transaction.End"
			
 
				+
			
 
				+
			
 
				+class Reason(str, Enum):
			
 
				+    """
			
 
				+    Reason for stopping a transaction in StopTransaction.req.
			
 
				+    """
			
 
				+
			
 
				+    emergency_stop = "EmergencyStop"
			
 
				+    ev_disconnected = "EVDisconnected"
			
 
				+    hard_reset = "HardReset"
			
 
				+    local = "Local"
			
 
				+    other = "Other"
			
 
				+    power_loss = "PowerLoss"
			
 
				+    reboot = "Reboot"
			
 
				+    remote = "Remote"
			
 
				+    soft_reset = "SoftReset"
			
 
				+    unlock_command = "UnlockCommand"
			
 
				+    de_authorized = "DeAuthorized"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    emergencyStop = "EmergencyStop"
			
 
				+    evDisconnected = "EVDisconnected"
			
 
				+    hardReset = "HardReset"
			
 
				+    powerLoss = "PowerLoss"
			
 
				+    softReset = "SoftReset"
			
 
				+    unlockCommand = "UnlockCommand"
			
 
				+    deAuthorized = "DeAuthorized"
			
 
				+
			
 
				+
			
 
				+class RecurrencyKind(str, Enum):
			
 
				+    """
			
 
				+    "Daily": The schedule restarts at the beginning of the next day.
			
 
				+    "Weekly": The schedule restarts at the beginning of the next week
			
 
				+              (defined as Monday morning)
			
 
				+    """
			
 
				+
			
 
				+    daily = "Daily"
			
 
				+    weekly = "Weekly"
			
 
				+
			
 
				+
			
 
				+class RegistrationStatus(str, Enum):
			
 
				+    """
			
 
				+    Result of registration in response to BootNotification.req.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    pending = "Pending"
			
 
				+    rejected = "Rejected"
			
 
				+
			
 
				+
			
 
				+class RemoteStartStopStatus(str, Enum):
			
 
				+    """
			
 
				+    The result of a RemoteStartTransaction.req or RemoteStopTransaction.req
			
 
				+    request.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+
			
 
				+
			
 
				+class ReservationStatus(str, Enum):
			
 
				+    """
			
 
				+    Status in ReserveNow.conf.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    faulted = "Faulted"
			
 
				+    occupied = "Occupied"
			
 
				+    rejected = "Rejected"
			
 
				+    unavailable = "Unavailable"
			
 
				+
			
 
				+
			
 
				+class ResetStatus(str, Enum):
			
 
				+    """
			
 
				+    Result of Reset.req
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+
			
 
				+
			
 
				+class ResetType(str, Enum):
			
 
				+    """
			
 
				+    Type of reset requested by Reset.req
			
 
				+    """
			
 
				+
			
 
				+    hard = "Hard"
			
 
				+    soft = "Soft"
			
 
				+
			
 
				+
			
 
				+class TriggerMessageStatus(str, Enum):
			
 
				+    """
			
 
				+    Status in TriggerMessage.conf.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+    not_implemented = "NotImplemented"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    notImplemented = "NotImplemented"
			
 
				+
			
 
				+
			
 
				+class UnitOfMeasure(str, Enum):
			
 
				+    """
			
 
				+    Allowable values of the optional "unit" field of a Value element, as used
			
 
				+    in MeterValues.req and StopTransaction.req messages. Default value of
			
 
				+    "unit" is always "Wh".
			
 
				+    """
			
 
				+
			
 
				+    wh = "Wh"
			
 
				+    kwh = "kWh"
			
 
				+    varh = "varh"
			
 
				+    kvarh = "kvarh"
			
 
				+    w = "W"
			
 
				+    kw = "kW"
			
 
				+    va = "VA"
			
 
				+    kva = "kVA"
			
 
				+    var = "var"
			
 
				+    kvar = "kvar"
			
 
				+    a = "A"
			
 
				+    v = "V"
			
 
				+    celsius = "Celsius"
			
 
				+    fahrenheit = "Fahrenheit"
			
 
				+    k = "K"
			
 
				+    percent = "Percent"
			
 
				+    hertz = "Hertz"
			
 
				+
			
 
				+
			
 
				+class UnlockStatus(str, Enum):
			
 
				+    """
			
 
				+    Status in response to UnlockConnector.req.
			
 
				+    """
			
 
				+
			
 
				+    unlocked = "Unlocked"
			
 
				+    unlock_failed = "UnlockFailed"
			
 
				+    not_supported = "NotSupported"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    unlockFailed = "UnlockFailed"
			
 
				+    notSupported = "NotSupported"
			
 
				+
			
 
				+
			
 
				+class UpdateFirmwareStatus(str, Enum):
			
 
				+    """
			
 
				+    UpdateFirmwareStatusEnumType is used by: SignedUpdateFirmware.conf
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    rejected = "Rejected"
			
 
				+    accepted_canceled = "AcceptedCanceled"
			
 
				+    invalid_certificate = "InvalidCertificate"
			
 
				+    revoked_certificate = "RevokedCertificate"
			
 
				+
			
 
				+
			
 
				+class UploadLogStatus(str, Enum):
			
 
				+    """
			
 
				+    UploadLogStatusEnumType is used by: LogStatusNotification.req
			
 
				+    """
			
 
				+
			
 
				+    bad_message = "BadMessage"
			
 
				+    idle = "Idle"
			
 
				+    not_supported_operation = "NotSupportedOperation"
			
 
				+    permission_denied = "PermissionDenied"
			
 
				+    uploaded = "Uploaded"
			
 
				+    upload_failure = "UploadFailure"
			
 
				+    uploading = "Uploading"
			
 
				+
			
 
				+
			
 
				+class UpdateStatus(str, Enum):
			
 
				+    """
			
 
				+    Type of update for a SendLocalList.req.
			
 
				+    """
			
 
				+
			
 
				+    accepted = "Accepted"
			
 
				+    failed = "Failed"
			
 
				+    not_supported = "NotSupported"
			
 
				+    version_mismatch = "VersionMismatch"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    notSupported = "NotSupported"
			
 
				+    versionMismatch = "VersionMismatch"
			
 
				+
			
 
				+
			
 
				+class UpdateType(str, Enum):
			
 
				+    """
			
 
				+    Type of update for a SendLocalList.req.
			
 
				+    """
			
 
				+
			
 
				+    differential = "Differential"
			
 
				+    full = "Full"
			
 
				+
			
 
				+
			
 
				+class ValueFormat(str, Enum):
			
 
				+    """
			
 
				+    Format that specifies how the value element in SampledValue is to be
			
 
				+    interpreted.
			
 
				+    """
			
 
				+
			
 
				+    raw = "Raw"
			
 
				+    signed_data = "SignedData"
			
 
				+
			
 
				+    # Soon to be deprecated enums
			
 
				+    signedData = "SignedData"
			
--- a/ocpp/ocpp/v16/schemas/Authorize.json
+++ b/ocpp/ocpp/v16/schemas/Authorize.json
@@ -0,0 +1,15 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "AuthorizeRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "idTag": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 20
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "idTag"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/AuthorizeResponse.json
+++ b/ocpp/ocpp/v16/schemas/AuthorizeResponse.json
@@ -0,0 +1,39 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "AuthorizeResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "idTagInfo": {
			
 
				+            "type": "object",
			
 
				+            "properties": {
			
 
				+                "expiryDate": {
			
 
				+                    "type": "string",
			
 
				+                    "format": "date-time"
			
 
				+                },
			
 
				+                "parentIdTag": {
			
 
				+                    "type": "string",
			
 
				+                    "maxLength": 20
			
 
				+                },
			
 
				+                "status": {
			
 
				+                    "type": "string",
			
 
				+                    "additionalProperties": false,
			
 
				+                    "enum": [
			
 
				+                        "Accepted",
			
 
				+                        "Blocked",
			
 
				+                        "Expired",
			
 
				+                        "Invalid",
			
 
				+                        "ConcurrentTx"
			
 
				+                    ]
			
 
				+                }
			
 
				+            },
			
 
				+            "additionalProperties": false,
			
 
				+            "required": [
			
 
				+                "status"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "idTagInfo"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/BootNotification.json
+++ b/ocpp/ocpp/v16/schemas/BootNotification.json
@@ -0,0 +1,48 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "BootNotificationRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "chargePointVendor": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 20
			
 
				+        },
			
 
				+        "chargePointModel": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 20
			
 
				+        },
			
 
				+        "chargePointSerialNumber": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 25
			
 
				+        },
			
 
				+        "chargeBoxSerialNumber": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 25
			
 
				+        },
			
 
				+        "firmwareVersion": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 50
			
 
				+        },
			
 
				+        "iccid": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 20
			
 
				+        },
			
 
				+        "imsi": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 20
			
 
				+        },
			
 
				+        "meterType": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 25
			
 
				+        },
			
 
				+        "meterSerialNumber": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 25
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "chargePointVendor",
			
 
				+        "chargePointModel"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/BootNotificationResponse.json
+++ b/ocpp/ocpp/v16/schemas/BootNotificationResponse.json
@@ -0,0 +1,29 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "BootNotificationResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Pending",
			
 
				+                "Rejected"
			
 
				+            ]
			
 
				+        },
			
 
				+        "currentTime": {
			
 
				+            "type": "string",
			
 
				+            "format": "date-time"
			
 
				+        },
			
 
				+        "interval": {
			
 
				+            "type": "integer"
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status",
			
 
				+        "currentTime",
			
 
				+        "interval"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/CancelReservation.json
+++ b/ocpp/ocpp/v16/schemas/CancelReservation.json
@@ -0,0 +1,14 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "CancelReservationRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "reservationId": {
			
 
				+            "type": "integer"
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "reservationId"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/CancelReservationResponse.json
+++ b/ocpp/ocpp/v16/schemas/CancelReservationResponse.json
@@ -0,0 +1,19 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "CancelReservationResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Rejected"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/CertificateSigned.json
+++ b/ocpp/ocpp/v16/schemas/CertificateSigned.json
@@ -0,0 +1,15 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:CertificateSigned.req",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "certificateChain": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 10000
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "certificateChain"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/CertificateSignedResponse.json
+++ b/ocpp/ocpp/v16/schemas/CertificateSignedResponse.json
@@ -0,0 +1,24 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:CertificateSigned.conf",
			
 
				+  "definitions": {
			
 
				+    "CertificateSignedStatusEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "Accepted",
			
 
				+        "Rejected"
			
 
				+      ]
			
 
				+    }
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {
			
 
				+    "status": {
			
 
				+      "$ref": "#/definitions/CertificateSignedStatusEnumType"
			
 
				+    }
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "status"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ChangeAvailability.json
+++ b/ocpp/ocpp/v16/schemas/ChangeAvailability.json
@@ -0,0 +1,23 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ChangeAvailabilityRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "connectorId": {
			
 
				+            "type": "integer"
			
 
				+        },
			
 
				+        "type": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Inoperative",
			
 
				+                "Operative"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "connectorId",
			
 
				+        "type"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ChangeAvailabilityResponse.json
+++ b/ocpp/ocpp/v16/schemas/ChangeAvailabilityResponse.json
@@ -0,0 +1,20 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ChangeAvailabilityResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Rejected",
			
 
				+                "Scheduled"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ChangeConfiguration.json
+++ b/ocpp/ocpp/v16/schemas/ChangeConfiguration.json
@@ -0,0 +1,20 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ChangeConfigurationRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "key": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 50
			
 
				+        },
			
 
				+        "value": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 500
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "key",
			
 
				+        "value"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ChangeConfigurationResponse.json
+++ b/ocpp/ocpp/v16/schemas/ChangeConfigurationResponse.json
@@ -0,0 +1,21 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ChangeConfigurationResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Rejected",
			
 
				+                "RebootRequired",
			
 
				+                "NotSupported"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ClearCache.json
+++ b/ocpp/ocpp/v16/schemas/ClearCache.json
@@ -0,0 +1,7 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ClearCacheRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {},
			
 
				+    "additionalProperties": false
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ClearCacheResponse.json
+++ b/ocpp/ocpp/v16/schemas/ClearCacheResponse.json
@@ -0,0 +1,19 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ClearCacheResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Rejected"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ClearChargingProfile.json
+++ b/ocpp/ocpp/v16/schemas/ClearChargingProfile.json
@@ -0,0 +1,26 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ClearChargingProfileRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "id": {
			
 
				+            "type": "integer"
			
 
				+        },
			
 
				+        "connectorId": {
			
 
				+            "type": "integer"
			
 
				+        },
			
 
				+        "chargingProfilePurpose": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "ChargePointMaxProfile",
			
 
				+                "TxDefaultProfile",
			
 
				+                "TxProfile"
			
 
				+            ]
			
 
				+        },
			
 
				+        "stackLevel": {
			
 
				+            "type": "integer"
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ClearChargingProfileResponse.json
+++ b/ocpp/ocpp/v16/schemas/ClearChargingProfileResponse.json
@@ -0,0 +1,19 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ClearChargingProfileResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Unknown"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/DataTransfer.json
+++ b/ocpp/ocpp/v16/schemas/DataTransfer.json
@@ -0,0 +1,22 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "DataTransferRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "vendorId": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 255
			
 
				+        },
			
 
				+        "messageId": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 50
			
 
				+        },
			
 
				+        "data": {
			
 
				+            "type": "string"
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "vendorId"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/DataTransferResponse.json
+++ b/ocpp/ocpp/v16/schemas/DataTransferResponse.json
@@ -0,0 +1,24 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "DataTransferResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Rejected",
			
 
				+                "UnknownMessageId",
			
 
				+                "UnknownVendorId"
			
 
				+            ]
			
 
				+        },
			
 
				+        "data": {
			
 
				+            "type": "string"
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/DeleteCertificate.json
+++ b/ocpp/ocpp/v16/schemas/DeleteCertificate.json
@@ -0,0 +1,52 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:DeleteCertificate.req",
			
 
				+  "definitions": {
			
 
				+    "HashAlgorithmEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "SHA256",
			
 
				+        "SHA384",
			
 
				+        "SHA512"
			
 
				+      ]
			
 
				+    },
			
 
				+    "CertificateHashDataType": {
			
 
				+      "type": "object",
			
 
				+      "additionalProperties": false,
			
 
				+      "properties": {
			
 
				+        "hashAlgorithm": {
			
 
				+          "$ref": "#/definitions/HashAlgorithmEnumType"
			
 
				+        },
			
 
				+        "issuerNameHash": {
			
 
				+          "type": "string",
			
 
				+          "maxLength": 128
			
 
				+        },
			
 
				+        "issuerKeyHash": {
			
 
				+          "type": "string",
			
 
				+          "maxLength": 128
			
 
				+        },
			
 
				+        "serialNumber": {
			
 
				+          "type": "string",
			
 
				+          "maxLength": 40
			
 
				+        }
			
 
				+      },
			
 
				+      "required": [
			
 
				+        "hashAlgorithm",
			
 
				+        "issuerNameHash",
			
 
				+        "issuerKeyHash",
			
 
				+        "serialNumber"
			
 
				+      ]
			
 
				+    }
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {
			
 
				+    "certificateHashData": {
			
 
				+      "$ref": "#/definitions/CertificateHashDataType"
			
 
				+    }
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "certificateHashData"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/DeleteCertificateResponse.json
+++ b/ocpp/ocpp/v16/schemas/DeleteCertificateResponse.json
@@ -0,0 +1,25 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:DeleteCertificate.conf",
			
 
				+  "definitions": {
			
 
				+    "DeleteCertificateStatusEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "Accepted",
			
 
				+        "Failed",
			
 
				+        "NotFound"
			
 
				+      ]
			
 
				+    }
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {
			
 
				+    "status": {
			
 
				+      "$ref": "#/definitions/DeleteCertificateStatusEnumType"
			
 
				+    }
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "status"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/DiagnosticsStatusNotification.json
+++ b/ocpp/ocpp/v16/schemas/DiagnosticsStatusNotification.json
@@ -0,0 +1,21 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "DiagnosticsStatusNotificationRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Idle",
			
 
				+                "Uploaded",
			
 
				+                "UploadFailed",
			
 
				+                "Uploading"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/DiagnosticsStatusNotificationResponse.json
+++ b/ocpp/ocpp/v16/schemas/DiagnosticsStatusNotificationResponse.json
@@ -0,0 +1,7 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "DiagnosticsStatusNotificationResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {},
			
 
				+    "additionalProperties": false
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ExtendedTriggerMessage.json
+++ b/ocpp/ocpp/v16/schemas/ExtendedTriggerMessage.json
@@ -0,0 +1,32 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:ExtendedTriggerMessage.req",
			
 
				+  "definitions": {
			
 
				+    "MessageTriggerEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "BootNotification",
			
 
				+        "LogStatusNotification",
			
 
				+        "FirmwareStatusNotification",
			
 
				+        "Heartbeat",
			
 
				+        "MeterValues",
			
 
				+        "SignChargePointCertificate",        
			
 
				+        "StatusNotification"        
			
 
				+      ]
			
 
				+    }	  
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {    
			
 
				+    "requestedMessage": {
			
 
				+      "$ref": "#/definitions/MessageTriggerEnumType"
			
 
				+    },
			
 
				+	"connectorId": {
			
 
				+          "type": "integer"
			
 
				+    }  
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "requestedMessage"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ExtendedTriggerMessageResponse.json
+++ b/ocpp/ocpp/v16/schemas/ExtendedTriggerMessageResponse.json
@@ -0,0 +1,25 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:ExtendedTriggerMessage.conf",
			
 
				+  "definitions": {
			
 
				+    "TriggerMessageStatusEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "Accepted",
			
 
				+        "Rejected",
			
 
				+        "NotImplemented"
			
 
				+      ]
			
 
				+    }
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {
			
 
				+    "status": {
			
 
				+      "$ref": "#/definitions/TriggerMessageStatusEnumType"
			
 
				+    }
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "status"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/FirmwareStatusNotification.json
+++ b/ocpp/ocpp/v16/schemas/FirmwareStatusNotification.json
@@ -0,0 +1,24 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "FirmwareStatusNotificationRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Downloaded",
			
 
				+                "DownloadFailed",
			
 
				+                "Downloading",
			
 
				+                "Idle",
			
 
				+                "InstallationFailed",
			
 
				+                "Installing",
			
 
				+                "Installed"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/FirmwareStatusNotificationResponse.json
+++ b/ocpp/ocpp/v16/schemas/FirmwareStatusNotificationResponse.json
@@ -0,0 +1,7 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "FirmwareStatusNotificationResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {},
			
 
				+    "additionalProperties": false
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetCompositeSchedule.json
+++ b/ocpp/ocpp/v16/schemas/GetCompositeSchedule.json
@@ -0,0 +1,26 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "GetCompositeScheduleRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "connectorId": {
			
 
				+            "type": "integer"
			
 
				+        },
			
 
				+    "duration": {
			
 
				+        "type": "integer"
			
 
				+    },
			
 
				+    "chargingRateUnit": {
			
 
				+        "type": "string",
			
 
				+        "additionalProperties": false,
			
 
				+        "enum": [
			
 
				+            "A",
			
 
				+            "W"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "connectorId",
			
 
				+        "duration"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetCompositeScheduleResponse.json
+++ b/ocpp/ocpp/v16/schemas/GetCompositeScheduleResponse.json
@@ -0,0 +1,78 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "GetCompositeScheduleResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Rejected"
			
 
				+            ]
			
 
				+        },
			
 
				+    "connectorId": {
			
 
				+        "type": "integer"
			
 
				+        },
			
 
				+    "scheduleStart": {
			
 
				+        "type": "string",
			
 
				+        "format": "date-time"
			
 
				+    },
			
 
				+    "chargingSchedule": {
			
 
				+        "type": "object",
			
 
				+        "properties": {
			
 
				+            "duration": {
			
 
				+                "type": "integer"
			
 
				+            },
			
 
				+            "startSchedule": {
			
 
				+                "type": "string",
			
 
				+                "format": "date-time"
			
 
				+            },
			
 
				+            "chargingRateUnit": {
			
 
				+                "type": "string",
			
 
				+                "additionalProperties": false,
			
 
				+                "enum": [
			
 
				+                    "A",
			
 
				+                    "W"
			
 
				+                    ]
			
 
				+            },
			
 
				+            "chargingSchedulePeriod": {
			
 
				+                "type": "array",
			
 
				+                "items": {
			
 
				+                    "type": "object",
			
 
				+                    "properties": {
			
 
				+                        "startPeriod": {
			
 
				+                            "type": "integer"
			
 
				+                        },
			
 
				+                        "limit": {
			
 
				+                            "type": "number",
			
 
				+                            "multipleOf" : 0.1
			
 
				+                        },
			
 
				+                        "numberPhases": {
			
 
				+                            "type": "integer"
			
 
				+                        }
			
 
				+                    },
			
 
				+                    "additionalProperties": false,
			
 
				+                    "required": [
			
 
				+                        "startPeriod",
			
 
				+                        "limit"
			
 
				+                        ]
			
 
				+                }
			
 
				+            },
			
 
				+            "minChargingRate": {
			
 
				+                "type": "number",
			
 
				+                "multipleOf" : 0.1
			
 
				+            }
			
 
				+        },
			
 
				+        "additionalProperties": false,
			
 
				+        "required": [
			
 
				+            "chargingRateUnit",
			
 
				+            "chargingSchedulePeriod"
			
 
				+        ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetConfiguration.json
+++ b/ocpp/ocpp/v16/schemas/GetConfiguration.json
@@ -0,0 +1,15 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "GetConfigurationRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "key": {
			
 
				+            "type": "array",
			
 
				+            "items": {
			
 
				+                "type": "string",
			
 
				+                "maxLength": 50
			
 
				+            }
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetConfigurationResponse.json
+++ b/ocpp/ocpp/v16/schemas/GetConfigurationResponse.json
@@ -0,0 +1,39 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "GetConfigurationResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "configurationKey": {
			
 
				+            "type": "array",
			
 
				+            "items": {
			
 
				+                "type": "object",
			
 
				+                "properties": {
			
 
				+                    "key": {
			
 
				+                        "type": "string",
			
 
				+                        "maxLength": 50
			
 
				+                    },
			
 
				+                    "readonly": {
			
 
				+                        "type": "boolean"
			
 
				+                    },
			
 
				+                    "value": {
			
 
				+                        "type": "string",
			
 
				+                        "maxLength": 500
			
 
				+                    }
			
 
				+                },
			
 
				+                "additionalProperties": false,
			
 
				+                "required": [
			
 
				+                    "key",
			
 
				+                    "readonly"
			
 
				+                ]
			
 
				+            }
			
 
				+        },
			
 
				+        "unknownKey": {
			
 
				+            "type": "array",
			
 
				+            "items": {
			
 
				+                "type": "string",
			
 
				+                "maxLength": 50
			
 
				+            }
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetDiagnostics.json
+++ b/ocpp/ocpp/v16/schemas/GetDiagnostics.json
@@ -0,0 +1,29 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "GetDiagnosticsRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "location": {
			
 
				+            "type": "string",
			
 
				+            "format": "uri"
			
 
				+        },
			
 
				+        "retries": {
			
 
				+            "type": "integer"
			
 
				+        },
			
 
				+        "retryInterval": {
			
 
				+            "type": "integer"
			
 
				+        },
			
 
				+        "startTime": {
			
 
				+            "type": "string",
			
 
				+            "format": "date-time"
			
 
				+        },
			
 
				+        "stopTime": {
			
 
				+            "type": "string",
			
 
				+            "format": "date-time"
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "location"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetDiagnosticsResponse.json
+++ b/ocpp/ocpp/v16/schemas/GetDiagnosticsResponse.json
@@ -0,0 +1,12 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "GetDiagnosticsResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "fileName": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 255
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetInstalledCertificateIds.json
+++ b/ocpp/ocpp/v16/schemas/GetInstalledCertificateIds.json
@@ -0,0 +1,24 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:GetInstalledCertificateIds.req",
			
 
				+  "definitions": {
			
 
				+    "CertificateUseEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "CentralSystemRootCertificate",
			
 
				+        "ManufacturerRootCertificate"
			
 
				+      ]
			
 
				+    }
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {
			
 
				+    "certificateType": {
			
 
				+      "$ref": "#/definitions/CertificateUseEnumType"
			
 
				+    }
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "certificateType"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetInstalledCertificateIdsResponse.json
+++ b/ocpp/ocpp/v16/schemas/GetInstalledCertificateIdsResponse.json
@@ -0,0 +1,69 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:GetInstalledCertificateIds.conf",
			
 
				+  "definitions": {
			
 
				+    "GetInstalledCertificateStatusEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "Accepted",
			
 
				+        "NotFound"
			
 
				+      ]
			
 
				+    },
			
 
				+    "HashAlgorithmEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "SHA256",
			
 
				+        "SHA384",
			
 
				+        "SHA512"
			
 
				+      ]
			
 
				+    },
			
 
				+    "CertificateHashDataType": {
			
 
				+      "javaType": "CertificateHashData",
			
 
				+      "type": "object",
			
 
				+      "additionalProperties": false,
			
 
				+      "properties": {
			
 
				+        "hashAlgorithm": {
			
 
				+          "$ref": "#/definitions/HashAlgorithmEnumType"
			
 
				+        },
			
 
				+        "issuerNameHash": {
			
 
				+          "type": "string",
			
 
				+          "maxLength": 128
			
 
				+        },
			
 
				+        "issuerKeyHash": {
			
 
				+          "type": "string",
			
 
				+          "maxLength": 128
			
 
				+        },
			
 
				+        "serialNumber": {
			
 
				+          "type": "string",
			
 
				+          "maxLength": 40
			
 
				+        }
			
 
				+      },
			
 
				+      "required": [
			
 
				+        "hashAlgorithm",
			
 
				+        "issuerNameHash",
			
 
				+        "issuerKeyHash",
			
 
				+        "serialNumber"
			
 
				+      ]
			
 
				+    }
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {
			
 
				+    "certificateHashData": {
			
 
				+      "type": "array",
			
 
				+      "additionalItems": false,
			
 
				+      "items": {
			
 
				+        "$ref": "#/definitions/CertificateHashDataType"
			
 
				+      },
			
 
				+      "minItems": 1
			
 
				+    },
			
 
				+    "status": {
			
 
				+      "$ref": "#/definitions/GetInstalledCertificateStatusEnumType"
			
 
				+    }
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "status"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetLocalListVersion.json
+++ b/ocpp/ocpp/v16/schemas/GetLocalListVersion.json
@@ -0,0 +1,7 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "GetLocalListVersionRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {},
			
 
				+    "additionalProperties": false
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetLocalListVersionResponse.json
+++ b/ocpp/ocpp/v16/schemas/GetLocalListVersionResponse.json
@@ -0,0 +1,14 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "GetLocalListVersionResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "listVersion": {
			
 
				+            "type": "integer"
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "listVersion"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetLog.json
+++ b/ocpp/ocpp/v16/schemas/GetLog.json
@@ -0,0 +1,59 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:GetLog.req",
			
 
				+  "definitions": {
			
 
				+    "LogEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "DiagnosticsLog",
			
 
				+        "SecurityLog"
			
 
				+      ]
			
 
				+    },
			
 
				+    "LogParametersType": {
			
 
				+      "type": "object",
			
 
				+      "additionalProperties": false,
			
 
				+      "properties": {
			
 
				+        "remoteLocation": {
			
 
				+          "type": "string",
			
 
				+          "maxLength": 512
			
 
				+        },
			
 
				+        "oldestTimestamp": {
			
 
				+          "type": "string",
			
 
				+          "format": "date-time"
			
 
				+        },
			
 
				+        "latestTimestamp": {
			
 
				+          "type": "string",
			
 
				+          "format": "date-time"
			
 
				+        }
			
 
				+      },
			
 
				+      "required": [
			
 
				+        "remoteLocation"
			
 
				+      ]
			
 
				+    }
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {
			
 
				+    "log": {
			
 
				+      "$ref": "#/definitions/LogParametersType"
			
 
				+    },
			
 
				+    "logType": {
			
 
				+      "$ref": "#/definitions/LogEnumType"
			
 
				+    },
			
 
				+    "requestId": {
			
 
				+      "type": "integer"
			
 
				+    },
			
 
				+    "retries": {
			
 
				+      "type": "integer"
			
 
				+    },
			
 
				+    "retryInterval": {
			
 
				+      "type": "integer"
			
 
				+    }
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "logType",
			
 
				+    "requestId",
			
 
				+    "log"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/GetLogResponse.json
+++ b/ocpp/ocpp/v16/schemas/GetLogResponse.json
@@ -0,0 +1,29 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:GetLog.conf",
			
 
				+  "definitions": {
			
 
				+    "LogStatusEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "Accepted",
			
 
				+        "Rejected",
			
 
				+        "AcceptedCanceled"
			
 
				+      ]
			
 
				+    }
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {
			
 
				+    "status": {
			
 
				+      "$ref": "#/definitions/LogStatusEnumType"
			
 
				+    },
			
 
				+    "filename": {
			
 
				+      "type": "string",
			
 
				+      "maxLength": 255
			
 
				+    }
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "status"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/Heartbeat.json
+++ b/ocpp/ocpp/v16/schemas/Heartbeat.json
@@ -0,0 +1,7 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "HeartbeatRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {},
			
 
				+    "additionalProperties": false
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/HeartbeatResponse.json
+++ b/ocpp/ocpp/v16/schemas/HeartbeatResponse.json
@@ -0,0 +1,15 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "HeartbeatResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "currentTime": {
			
 
				+            "type": "string",
			
 
				+            "format": "date-time"
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "currentTime"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/InstallCertificate.json
+++ b/ocpp/ocpp/v16/schemas/InstallCertificate.json
@@ -0,0 +1,29 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:InstallCertificate.req",
			
 
				+  "definitions": {
			
 
				+    "CertificateUseEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "CentralSystemRootCertificate",
			
 
				+        "ManufacturerRootCertificate"
			
 
				+      ]
			
 
				+    }
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {
			
 
				+    "certificateType": {
			
 
				+      "$ref": "#/definitions/CertificateUseEnumType"
			
 
				+    },
			
 
				+    "certificate": {
			
 
				+      "type": "string",
			
 
				+      "maxLength": 5500
			
 
				+    }
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "certificateType",
			
 
				+    "certificate"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/InstallCertificateResponse.json
+++ b/ocpp/ocpp/v16/schemas/InstallCertificateResponse.json
@@ -0,0 +1,25 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:InstallCertificate.conf",
			
 
				+  "definitions": {
			
 
				+    "InstallCertificateStatusEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "Accepted",
			
 
				+        "Failed",
			
 
				+        "Rejected"
			
 
				+      ]
			
 
				+    }
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {
			
 
				+    "status": {
			
 
				+      "$ref": "#/definitions/InstallCertificateStatusEnumType"
			
 
				+    }
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "status"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/LogStatusNotification.json
+++ b/ocpp/ocpp/v16/schemas/LogStatusNotification.json
@@ -0,0 +1,32 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:LogStatusNotification.req",
			
 
				+  "definitions": {
			
 
				+    "UploadLogStatusEnumType": {
			
 
				+      "type": "string",
			
 
				+      "additionalProperties": false,
			
 
				+      "enum": [
			
 
				+        "BadMessage",
			
 
				+        "Idle",
			
 
				+        "NotSupportedOperation",
			
 
				+        "PermissionDenied",
			
 
				+        "Uploaded",
			
 
				+        "UploadFailure",
			
 
				+        "Uploading"
			
 
				+      ]
			
 
				+    }
			
 
				+  },
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false,
			
 
				+  "properties": {
			
 
				+    "status": {
			
 
				+      "$ref": "#/definitions/UploadLogStatusEnumType"
			
 
				+    },
			
 
				+    "requestId": {
			
 
				+      "type": "integer"
			
 
				+    }
			
 
				+  },
			
 
				+  "required": [
			
 
				+    "status"
			
 
				+  ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/LogStatusNotificationResponse.json
+++ b/ocpp/ocpp/v16/schemas/LogStatusNotificationResponse.json
@@ -0,0 +1,6 @@
 
				+{
			
 
				+  "$schema": "http://json-schema.org/draft-06/schema#",
			
 
				+  "$id": "urn:OCPP:Cp:1.6:2020:3:LogStatusNotification.conf",
			
 
				+  "type": "object",
			
 
				+  "additionalProperties": false
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/MeterValues.json
+++ b/ocpp/ocpp/v16/schemas/MeterValues.json
@@ -0,0 +1,153 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "MeterValuesRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "connectorId": {
			
 
				+            "type": "integer"
			
 
				+        },
			
 
				+        "transactionId": {
			
 
				+            "type": "integer"
			
 
				+        },
			
 
				+        "meterValue": {
			
 
				+            "type": "array",
			
 
				+            "minItems": 1,
			
 
				+            "items": {
			
 
				+                "type": "object",
			
 
				+                "properties": {
			
 
				+                    "timestamp": {
			
 
				+                        "type": "string",
			
 
				+                        "format": "date-time"
			
 
				+                    },
			
 
				+                    "sampledValue": {
			
 
				+                        "type": "array",
			
 
				+                        "minItems": 1,
			
 
				+                        "items": {
			
 
				+                            "type": "object",
			
 
				+                            "properties": {
			
 
				+                                "value": {
			
 
				+                                    "type": "string"
			
 
				+                                },
			
 
				+                                "context": {
			
 
				+                                    "type": "string",
			
 
				+                                    "additionalProperties": false,
			
 
				+                                    "enum": [
			
 
				+                                        "Interruption.Begin",
			
 
				+                                        "Interruption.End",
			
 
				+                                        "Sample.Clock",
			
 
				+                                        "Sample.Periodic",
			
 
				+                                        "Transaction.Begin",
			
 
				+                                        "Transaction.End",
			
 
				+                                        "Trigger",
			
 
				+                                        "Other"
			
 
				+                                    ]
			
 
				+                                },
			
 
				+                                "format": {
			
 
				+                                    "type": "string",
			
 
				+                                    "additionalProperties": false,
			
 
				+                                    "enum": [
			
 
				+                                        "Raw",
			
 
				+                                        "SignedData"
			
 
				+                                    ]
			
 
				+                                },
			
 
				+                                "measurand": {
			
 
				+                                    "type": "string",
			
 
				+                                    "additionalProperties": false,
			
 
				+                                    "enum": [
			
 
				+                                        "Energy.Active.Export.Register",
			
 
				+                                        "Energy.Active.Import.Register",
			
 
				+                                        "Energy.Reactive.Export.Register",
			
 
				+                                        "Energy.Reactive.Import.Register",
			
 
				+                                        "Energy.Active.Export.Interval",
			
 
				+                                        "Energy.Active.Import.Interval",
			
 
				+                                        "Energy.Reactive.Export.Interval",
			
 
				+                                        "Energy.Reactive.Import.Interval",
			
 
				+                                        "Power.Active.Export",
			
 
				+                                        "Power.Active.Import",
			
 
				+                                        "Power.Offered",
			
 
				+                                        "Power.Reactive.Export",
			
 
				+                                        "Power.Reactive.Import",
			
 
				+                                        "Power.Factor",
			
 
				+                                        "Current.Import",
			
 
				+                                        "Current.Export",
			
 
				+                                        "Current.Offered",
			
 
				+                                        "Voltage",
			
 
				+                                        "Frequency",
			
 
				+                                        "Temperature",
			
 
				+                                        "SoC",
			
 
				+                                        "RPM"
			
 
				+                                    ]
			
 
				+                                },
			
 
				+                                "phase": {
			
 
				+                                    "type": "string",
			
 
				+                                    "additionalProperties": false,
			
 
				+                                    "enum": [
			
 
				+                                        "L1",
			
 
				+                                        "L2",
			
 
				+                                        "L3",
			
 
				+                                        "N",
			
 
				+                                        "L1-N",
			
 
				+                                        "L2-N",
			
 
				+                                        "L3-N",
			
 
				+                                        "L1-L2",
			
 
				+                                        "L2-L3",
			
 
				+                                        "L3-L1"
			
 
				+                                    ]
			
 
				+                                },
			
 
				+                                "location": {
			
 
				+                                    "type": "string",
			
 
				+                                    "additionalProperties": false,
			
 
				+                                    "enum": [
			
 
				+                                        "Cable",
			
 
				+                                        "EV",
			
 
				+                                        "Inlet",
			
 
				+                                        "Outlet",
			
 
				+                                        "Body"
			
 
				+                                    ]
			
 
				+                                },
			
 
				+                                "unit": {
			
 
				+                                    "type": "string",
			
 
				+                                    "additionalProperties": false,
			
 
				+                                    "enum": [
			
 
				+                                        "Wh",
			
 
				+                                        "kWh",
			
 
				+                                        "varh",
			
 
				+                                        "kvarh",
			
 
				+                                        "W",
			
 
				+                                        "kW",
			
 
				+                                        "VA",
			
 
				+                                        "kVA",
			
 
				+                                        "var",
			
 
				+                                        "kvar",
			
 
				+                                        "A",
			
 
				+                                        "V",
			
 
				+                                        "K",
			
 
				+                                        "Celcius",
			
 
				+                                        "Celsius",
			
 
				+                                        "Fahrenheit",
			
 
				+                                        "Percent",
			
 
				+                                        "Hertz"
			
 
				+                                    ]
			
 
				+                                }
			
 
				+                            },
			
 
				+                            "additionalProperties": false,
			
 
				+                            "required": [
			
 
				+                                "value"
			
 
				+                            ]
			
 
				+                        }
			
 
				+                    }
			
 
				+                },
			
 
				+                "additionalProperties": false,
			
 
				+                "required": [
			
 
				+                    "timestamp",
			
 
				+                    "sampledValue"
			
 
				+                ]       
			
 
				+            }
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "connectorId",
			
 
				+        "meterValue"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/MeterValuesResponse.json
+++ b/ocpp/ocpp/v16/schemas/MeterValuesResponse.json
@@ -0,0 +1,7 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "MeterValuesResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {},
			
 
				+    "additionalProperties": false
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/RemoteStartTransaction.json
+++ b/ocpp/ocpp/v16/schemas/RemoteStartTransaction.json
@@ -0,0 +1,126 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "RemoteStartTransactionRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "connectorId": {
			
 
				+            "type": "integer"
			
 
				+        },
			
 
				+        "idTag": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 20
			
 
				+        },
			
 
				+        "chargingProfile": {
			
 
				+            "type": "object",
			
 
				+            "properties": {
			
 
				+                "chargingProfileId": {
			
 
				+                    "type": "integer"
			
 
				+                },
			
 
				+                "transactionId": {
			
 
				+                    "type": "integer"
			
 
				+                },
			
 
				+                "stackLevel": {
			
 
				+                    "type": "integer"
			
 
				+                },
			
 
				+                "chargingProfilePurpose": {
			
 
				+                    "type": "string",
			
 
				+                    "additionalProperties": false,
			
 
				+                    "enum": [
			
 
				+                        "ChargePointMaxProfile",
			
 
				+                        "TxDefaultProfile",
			
 
				+                        "TxProfile"
			
 
				+                    ]
			
 
				+                },
			
 
				+                "chargingProfileKind": {
			
 
				+                    "type": "string",
			
 
				+                    "additionalProperties": false,
			
 
				+                    "enum": [
			
 
				+                        "Absolute",
			
 
				+                        "Recurring",
			
 
				+                        "Relative"
			
 
				+                    ]
			
 
				+                },
			
 
				+                "recurrencyKind": {
			
 
				+                    "type": "string",
			
 
				+                    "additionalProperties": false,
			
 
				+                    "enum": [
			
 
				+                        "Daily",
			
 
				+                        "Weekly"
			
 
				+                    ]
			
 
				+                },
			
 
				+                "validFrom": {
			
 
				+                    "type": "string",
			
 
				+                    "format": "date-time"
			
 
				+                },
			
 
				+                "validTo": {
			
 
				+                    "type": "string",
			
 
				+                    "format": "date-time"
			
 
				+                },
			
 
				+                "chargingSchedule": {
			
 
				+                    "type": "object",
			
 
				+                    "properties": {
			
 
				+                        "duration": {
			
 
				+                            "type": "integer"
			
 
				+                        },
			
 
				+                        "startSchedule": {
			
 
				+                            "type": "string",
			
 
				+                            "format": "date-time"
			
 
				+                        },
			
 
				+                        "chargingRateUnit": {
			
 
				+                            "type": "string",
			
 
				+                            "additionalProperties": false,
			
 
				+                            "enum": [
			
 
				+                                "A",
			
 
				+                                "W"
			
 
				+                            ]
			
 
				+                        },
			
 
				+                        "chargingSchedulePeriod": {
			
 
				+                            "type": "array",
			
 
				+                            "items": {
			
 
				+                                "type": "object",
			
 
				+                                "properties": {
			
 
				+                                    "startPeriod": {
			
 
				+                                        "type": "integer"
			
 
				+                                    },
			
 
				+                                    "limit": {
			
 
				+                                        "type": "number",
			
 
				+                                        "multipleOf" : 0.1
			
 
				+                                    },
			
 
				+                                    "numberPhases": {
			
 
				+                                        "type": "integer"
			
 
				+                                    }
			
 
				+                                },
			
 
				+                                "additionalProperties": false,
			
 
				+                                "required": [
			
 
				+                                    "startPeriod",
			
 
				+                                    "limit"
			
 
				+                                ]
			
 
				+                            }
			
 
				+                        },
			
 
				+                        "minChargingRate": {
			
 
				+                            "type": "number",
			
 
				+                            "multipleOf" : 0.1
			
 
				+                        }
			
 
				+                    },
			
 
				+                    "additionalProperties": false,
			
 
				+                    "required": [
			
 
				+                        "chargingRateUnit",
			
 
				+                        "chargingSchedulePeriod"
			
 
				+                    ]
			
 
				+                }
			
 
				+            },
			
 
				+            "additionalProperties": false,
			
 
				+            "required": [
			
 
				+                "chargingProfileId",
			
 
				+                "stackLevel",
			
 
				+                "chargingProfilePurpose",
			
 
				+                "chargingProfileKind",
			
 
				+                "chargingSchedule"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "idTag"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/RemoteStartTransactionResponse.json
+++ b/ocpp/ocpp/v16/schemas/RemoteStartTransactionResponse.json
@@ -0,0 +1,19 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "RemoteStartTransactionResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Rejected"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/RemoteStopTransaction.json
+++ b/ocpp/ocpp/v16/schemas/RemoteStopTransaction.json
@@ -0,0 +1,14 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "RemoteStopTransactionRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "transactionId": {
			
 
				+            "type": "integer"
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "transactionId"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/RemoteStopTransactionResponse.json
+++ b/ocpp/ocpp/v16/schemas/RemoteStopTransactionResponse.json
@@ -0,0 +1,19 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "RemoteStopTransactionResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Rejected"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ReserveNow.json
+++ b/ocpp/ocpp/v16/schemas/ReserveNow.json
@@ -0,0 +1,32 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ReserveNowRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "connectorId": {
			
 
				+            "type": "integer"
			
 
				+        },
			
 
				+        "expiryDate": {
			
 
				+            "type": "string",
			
 
				+            "format": "date-time"
			
 
				+        },
			
 
				+        "idTag": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 20
			
 
				+        },
			
 
				+        "parentIdTag": {
			
 
				+            "type": "string",
			
 
				+            "maxLength": 20
			
 
				+        },
			
 
				+        "reservationId": {
			
 
				+            "type": "integer"
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "connectorId",
			
 
				+        "expiryDate",
			
 
				+        "idTag",
			
 
				+        "reservationId"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ReserveNowResponse.json
+++ b/ocpp/ocpp/v16/schemas/ReserveNowResponse.json
@@ -0,0 +1,22 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ReserveNowResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Faulted",
			
 
				+                "Occupied",
			
 
				+                "Rejected",
			
 
				+                "Unavailable"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/Reset.json
+++ b/ocpp/ocpp/v16/schemas/Reset.json
@@ -0,0 +1,19 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ResetRequest",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "type": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Hard",
			
 
				+                "Soft"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "type"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/ResetResponse.json
+++ b/ocpp/ocpp/v16/schemas/ResetResponse.json
@@ -0,0 +1,19 @@
 
				+{
			
 
				+    "$schema": "http://json-schema.org/draft-04/schema#",
			
 
				+    "title": "ResetResponse",
			
 
				+    "type": "object",
			
 
				+    "properties": {
			
 
				+        "status": {
			
 
				+            "type": "string",
			
 
				+            "additionalProperties": false,
			
 
				+            "enum": [
			
 
				+                "Accepted",
			
 
				+                "Rejected"
			
 
				+            ]
			
 
				+        }
			
 
				+    },
			
 
				+    "additionalProperties": false,
			
 
				+    "required": [
			
 
				+        "status"
			
 
				+    ]
			
 
				+}
			
--- a/ocpp/ocpp/v16/schemas/SecurityEventNotification.json
+++ b/ocpp/ocpp/v16/schemas/SecurityEventNotification.json